DELHI DTU DU BSC QUESTION PAPERS




 

BSC-(APS)-APPLIED-PHYSICAL-SCIENCES-INDUSTRIAL-CHEMISTRY-2-(ICPT-202)-2-(6967)

BSC-(BOTANY)-(BIOCHEMISTRY)-(MICROBIOLOGY)-(ANTHROPOLOGY)-(ZOOLOGY)-SEM-IV

BSC-(ELECTRONICS)-MAHT-204-MATHEMATICS-1-SEM-II

BSC-(G)-(H)-(INCLUDING-(H)-PHYSICS-CHEMISTRY-MATH)-QUALIFYING-ENGLISH-A-PAPER-I

BSC-(G)-(H)-1-QUALIFYING-ENGLISH-B-PAPER-1-(TEXT-COMPOSITION-GRAMMAR-ETC-(982)

BSC-(G)-(H)-1-QUALIFYING-ENGLISH-B-PAPER-1-(TEXTCOMPOSITIONGRAMMARETC)

BSC-(G)-(H)-1-QUALIFYING-ENGLISH-ELECTIVE-PAPER-1-(NOVEL)-(983)

BSC-(G)-(H)-1-QUALIFYING-ENGLISH-ELECTIVE-PAPER-1-(NOVEL)

BSC-(G)-(H)-1-QUALIFYING-ENGLISH-PAPER-1-(TEXTCOMPOSITIONGRAMMARETC)

BSC-(G)-(H)-HISTORY-OF-SCIENCE-AND-SCIENTIEIC-METHOD

BSC-(G)-(H)-HISTORY-OF-SCIENCE-AND-SCIENTIFIC-METHOD-(8081)

BSC-(G)-(H)-HISTORY-OF-SCIENCE-AND-SCIENTIFIC-METHOD-1

BSC-(G)-(H)-HISTORY-OF-SCIENCE-AND-SCIENTIFIC-METHOD

BSC-(G)-(PHYSICAL-SCIENCE)-3-SEM-PAPER-MAPT-303-(ALGEBRA)

BSC-(G)-(QUALIFYING)-ACCOUNTANCY-ANNUAL-(8082)

BSC-(G)-1-CHEMISTRY-PAPER-I

BSC-(G)-1-CHEMISTRY-PAPER-II

BSC-(G)-1-COMPUTER-SCIENCE-PAPER-1-(PROGRAMMING-FUNDAMENTALS-AND-DATA-STRUCTURES)

BSC-(G)-1-COMPUTER-SCIENCE-PAPER-1-(PROGRAMMING-FUNDAMENTALS-AND-DATA-STRUTURES)-(8064)

BSC-(G)-1-COMPUTER-SCIENCE-PAPER-2-(COMPUTER-ORGANISATION-AND-OPERATING-SYSTEMS)-(8065)

BSC-(G)-1-COMPUTER-SCIENCE-PAPER-2-(COMPUTER-ORGANIZATION-AND-OPERATING-SYSTEMS)

BSC-(G)-1-COMPUTER-SCIENCE-PAPER-II

BSC-(G)-1-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-1-STATISTICAL-METHODS-1-V2

BSC-(G)-1-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-1-STATISTICAL-METHODS-1

BSC-(G)-1-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-2-PROBABLITY

BSC-(G)-1-MATHEMATICAL-SCIENCE-PAPER-1-ESSENTIALS-FOR-OPERATIONAL-RESEACH-(SATISTICS)

BSC-(G)-1-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)-PAPER-2-OPTIMIZATION-1

BSC-(G)-1-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-2-PROBABILITY-1

BSC-(G)-1-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-2-PROBABILITY

BSC-(G)-1-MATHEMATICAL-SCIENCES-1

BSC-(G)-1-MATHEMATICAL-SCIENCES-PAPER-1-ESSENTIALS-OF-OPERATIONAL-RESEARCH-(STATISTICS)

BSC-(G)-1-MATHEMATICAL-SCIENCES-PAPER-I

BSC-(G)-1-MATHEMATICAL-SCIENCES-PAPER-II

BSC-(G)-1-MATHEMATICAL-SCIENCES

BSC-(G)-1-MATHEMATICS-PAPER-1-(ALGEBRA)

BSC-(G)-1-MATHEMATICS-PAPER-1-ALGEBRA-(ADMISSIONS-OF-2004-AND-BEFORE)

BSC-(G)-1-MATHEMATICS-PAPER-2-(CALCULAS)

BSC-(G)-1-MATHEMATICS-PAPER-2-(CALCULUS)

BSC-(G)-1-MATHEMATICS-PAPER-2-CALCULUS

BSC-(G)-1-MATHEMATICS-PAPER-I

BSC-(G)-1-NS-CHEMISTRY-PAPER-1-(INORGANIC-CHEMISTRY)

BSC-(G)-1-NS-CHEMISTRY-PAPER-2-(ORGANIC-CHEMISTRY)

BSC-(G)-1-NS-CHEMISTRY-PAPER-3-PHYSICAL-CHEMISTRY

BSC-(G)-1-NS-COMPUTER-SCIENCE-PAPER-2-(2)

BSC-(G)-1-NS-COMPUTER-SCIENCE-PAPER-2-COMPUTER-ORGANISATION-AND-OPERATING-SYSTEM

BSC-(G)-1-NS-COMPUTER-SCIENCE-PAPER-II

BSC-(G)-1-NS-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)-PARER-2-OPTIMIZATION-1

BSC-(G)-1-NS-MATHEMATICAL-SCIENCES-PAPER-1-ESSENTIALS-FOR-OPERATIONAL-RESEARCH

BSC-(G)-1-NS-PHYSICS-PAPER-1-MATHEMATICS

BSC-(G)-1-NS-PHYSICS-PAPER-2-THERMAL-PHYSICS

BSC-(G)-1-NS-PHYSICS-PAPER-3-(WAVES-AND-OSCILLATIONS)

BSC-(G)-1-PAPER-1-MATHEMATICAL-SCIENCE-STATISTICAL-METHODS-1

BSC-(G)-1-PHYSICS-PAPER-I

BSC-(G)-1-PHYSICS-PAPER-II

BSC-(G)-1-ZOOLOGY-PAPER-I

BSC-(G)-1-ZOOLOGY-PAPER-II

BSC-(G)-2-(NS)-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)

BSC-(G)-2-COMPUTER-SCIENCE-PAPER-3-(OBJECT-ORIENTED-PROGRAMMING)

BSC-(G)-2-MATHEMATICAL-SCIENCE-(OPERATIONAL-RESEACH)-PAPER-(I)-1-NVENTORY-SYSTEM-AND-MARKETING-MANAGEMENT

BSC-(G)-2-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-3-STATISCAL-METHODS-2-PAPER-3-STATISTICAL-METHODS-2

BSC-(G)-2-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)-PAPER-3-1-NVENTORY-SYSTEM-AND-MARKETING-MANAGEMENT

BSC-(G)-2-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-IV

BSC-(G)-2-MATHEMATICS-PAPER-3-(GEOMATRY)

BSC-(G)-2-MATHEMATICS-PAPER-3-(GEOMETRY)-(8059)

BSC-(G)-2-MATHEMATICS-PAPER-3-(GEOMETRY)

BSC-(G)-2-MATHEMATICS-PAPER-3-GEOMETRY

BSC-(G)-2-MATHEMATICS-PAPER-IV-(VECTOR-CALCULUS-AND-DIFFERENTIAL-EQUATIONS)

BSC-(G)-2-MATHEMATICS-PAPER-IV-(VECTOR-CALCULUS-AND-DIFFRENTIAL-EQUATIONS)

BSC-(G)-2-MATHEMATICS-PAPER-IV-(VECTOR-CALCULUS-ANS-DIFFERENTIAL-EQUATIONS)-(8060)

BSC-(G)-2-MATHEMATICS-PAPER-IV-(VECTOR-CALULUS-AND-DIFFERENTIAL-EQUATIONS)

BSC-(G)-2-MATHEMATICS-PAPER-IV

BSC-(G)-2-NS-CHEMISTRY-PAPER-IV

BSC-(G)-2-NS-CHEMISTRY-PAPER-V

BSC-(G)-2-NS-COMPUTER-SCIENCE-PAPER-III

BSC-(G)-2-NS-COMPUTER-SCIENCE-PAPER-IV-(COMPUTER-NETWORKS-AND-INTERNET)-(8067)

BSC-(G)-2-NS-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH

BSC-(G)-2-NS-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-IV-APPLIED-STATISTICS

BSC-(G)-2-NS-PHYSICS-PAPRER-IV-ELECTROMAGNETISM

BSC-(G)-2-PHYSICS-PAPER-IV

BSC-(G)-2-QUALIFYING-DIGITAL-ELECTRONICS-PAPER-IV

BSC-(G)-3-CHEMISTRY-PAPER-IX

BSC-(G)-3-CHEMISTRY-PAPER-VII

BSC-(G)-3-CHEMISTRY-PAPER-VIII

BSC-(G)-3-COMPUTER-SCIENCE-PAPER-V-(DATA-BASE-SYSTEMS)-(8068)

BSC-(G)-3-COMPUTER-SCIENCE-PAPER-V

BSC-(G)-3-COMPUTER-SCIENCE-PAPER-VI-(MULTIMEDIA-SYSTEM-AND-APPLICATION-OPERATING-SYSTEM)-(8069)

BSC-(G)-3-COMPUTER-SCIENCES-PAPER-VI

BSC-(G)-3-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-V-STATISTICAL-INFERENCE

BSC-(G)-3-MATHEMATICAL-SCIENCE-(STATISTICS)-PAPER-VI-SAMPLE-SURVEYS-AND-DESIGN-OF-EXPERIMENTS

BSC-(G)-3-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)-PAPER-V-QUEUEING-THEORY-AND-RELIABILITY-(8055)

BSC-(G)-3-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-III

BSC-(G)-3-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-V-STATISTICAL-INFERENCE-(8074)

BSC-(G)-3-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-V

BSC-(G)-3-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-VI-(II)-STATISTICS

BSC-(G)-3-MATHEMATICAL-SCIENCES-(STATISTICS)-PAPER-VI

BSC-(G)-3-MATHEMATICS-PAPER-V-(REAL-ANALYSIS)

BSC-(G)-3-MATHEMATICS-PAPER-VI-(I)-(MECHANICS)

BSC-(G)-3-MATHEMATICS-PAPER-VI-(I)-MECHANICS

BSC-(G)-3-MATHEMATICS-PAPER-VI-(I)

BSC-(G)-3-MATHEMATICS-PAPER-VI-(II)-(STATISTICS)-(8063)

BSC-(G)-3-MATHEMATICS-PAPER-VI-(II)-STATISTICS

BSC-(G)-3-MATHEMATICS-PAPER-VI-(II)

BSC-(G)-3-NS-MATHEMATICS-PAPER-V-(REAL-ANALYSIS)-(8061)

BSC-(G)-3-NS-PHYSICS-PAPER-VI-QUAMTUM-PHYSICS-AND-ELECTRONICS

BSC-(G)-3-PHYSICS-PAPER-V-ATOMIC-PHYSICS

BSC-(G)-CHEMISTRY

BSC-(G)-MATHEMATICAL-SCIENCE-PAPER-ECONOMICS-(ECONOMIC-DEVELOPMENT-AND-PLANNING-IN-INDIA)-(8083)

BSC-(G)-MATHEMATICAL-SCIENCES-(II-YEAR)-OLD-COURSE-OBJECT-ORIENTED-PROGRAMMING-(PAPER-III)-(8066)

BSC-(G)-PART-2-QUALIFYING-DIGITAL-ELECTRONICS-(PAPER-IV)-(8084)

BSC-(G)-QULIFYING-ENGLISH-A-PAPER-1-(TEXT-COMPOSITION-GRAMMAR-ETC)

BSC-(GEN)-(H)-1-QUALPYING-ENGLISH-A-PAPER-1-(TEXT-COMPOSITION-GRAMMAR-ETC)-(981)

BSC-(GENERAL)-QUALIFYING-DIGITAL-ELECTRONICS

BSC-(H)-(ANTHROPOLOGYBIOCHEMISTRYBIOLOGICAL-SCIENCE-BIOMEDICAL-SCIENCE-SEM-3-(5952)

BSC-(H)-(ANTHROPOLOGYBIOCHEMISTRYBIOLOGICAL-SCIENCE-BIOMEDICAL-SSEM-3-(5952)

BSC-(H)-(ANTHROPOLOGYBIOCHEMISTRYBIOLOGICAL-SEM-3-(5952)

BSC-(H)-(ANTHROPOLOGYBIOCHEMISTRYBIOLOGICAL

BSC-(H)-(BOTANY-BIOCHEMISTRY-MICROBIOLOGY-ANTHROPOLOGY-ZOOLOGY)-3-SEM-PAPER-MBHT-301

BSC-(H)-(BOTANY-BIOCHEMISTRY-MICROBIOLOGY-ANTHROPOLOGY-ZOOLOGY)

BSC-(H)-(GEOLOGY)-(DC-1-1)-SEM-1-(7825)

BSC-(H)-(GEOLOGY)-(DC-1-2)-SEM-1-(7826)

BSC-(H)-(H)-MATH-(MATHCIENCE)-VING-SEM-VI-(1934)

BSC-(H)-(H)-MATH-(MATHEMATICAL-SCIENCE)-PSYCHOLOGY-FOR-LIVING-SEM-VI-(1934)

BSC-(H)-(H)-MATH-CAL-LOGIC-VI-(1930)

BSC-(H)-(H)-MATH-MATHEMATICAL-SCIENCE-SYMBOLIC-LOGIC-VI-(1930)

BSC-(H)-(H)-MATH-MATHEMATICALSOPHICAL-IN)

BSC-(H)-(H)-MATHA-VI-SEMESTER-(1935)

BSC-(H)-(H)-MATHEMATICAL-SCIENCE-(H)-MATHEMATICS-6831-SEM-1-3

BSC-(H)-(I-MICRBIOLOGY-PAPER-V-(BIOSTATISTICS-AND-INTRODUCTION-TO-COMPUTER)

BSC-(H)-(MATH)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2007)

BSC-(H)-(MATH)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2011)

BSC-(H)-(MATH)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2013)

BSC-(H)-(MATH)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2014)

BSC-(H)-(MATH)-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-12

BSC-(H)-(MATH)-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-127

BSC-(H)-(MATH)-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-1288-D

BSC-(H)-(MATH)-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-1298

BSC-(H)-(MATH)-HINDI-LANGUAGE

BSC-(H)-(MATH)-QUALIFYING-COURSE-PPER-3-SNSKRIT-LANGUAGE-SEM-1-(1838)

BSC-(H)-(MATH)-SNSKRIT-LANGUAGE-SEM-1-(1838)

BSC-(H)-(MATHS)-MATHEMATICS-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-12

BSC-(H)-(MATHS)-MATHEMATICS-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-127

BSC-(H)-(MATHS)-MATHEMATICS-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-1288-D

BSC-(H)-(MATHS)-MATHEMATICS-HINDI-LANGUAGE-LITERATURE-AND-CULTURE-6831-SEM-1-3-1298

BSC-(H)-(MATHS)-MATHS-SEMI-3-(1862)

BSC-(H)-(P)-BIOINFORMATICS-LSPT-409-SEM-IV

BSC-(H)-(P)-BIOLOGY-2-LSPT-202-SEM-II

BSC-(H)-(P)-CHEMISTRY-2-SEM-PAPER-LSPT-202-BIOLOGY-2-CELL-AND-CELLULAR-PRECESS

BSC-(H)-(P)-COMPUTATIONAL-SKILLS-(CSAT-101)-1SEM-1-(6805)

BSC-(H)-(P)-CSAT-201-COMPUTATIONAL-SKILLS-SEM-II

BSC-(H)-(P)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2008)

BSC-(H)-(P)-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2010)

BSC-(H)-(P)-INTRODUCTION-TO-BIOLOGY-LPST-101-SEM-1-(6281)

BSC-(H)-(P)-IST-SEM-PAPER-CSAT-101-COMPUTER-SCIENCE-(COMPUTATIONAL-SKILLS)

BSC-(H)-(P)-PAPER-COMPUTATIONAL-SKILLS-(CSAT-201)-SEMESTER-2-(6085)

BSC-(H)-)-BSC-MATHSSC-BSC

BSC-(H)-1-ANTHROPOLOGY-PAPER-1-(INTRODUCTION-TO-BIOLOGICAL-ANTHROPOLOGY)

BSC-(H)-1-ATATISTICS-PAPER-V-(STATISTICAL-MITHODS-1)

BSC-(H)-1-BIOCHEMISTRY-PAPER-1-(PHYSICAL-CHEMISTRY)

BSC-(H)-1-BIOCHEMISTRY-PAPER-2-(INORGANIC-AND-ORGANIC-CHEMISTRY)

BSC-(H)-1-BIOCHEMISTRY-PAPER-2

BSC-(H)-1-BIOCHEMISTRY-PAPER-3-(PHYSICS)

BSC-(H)-1-BIOCHEMISTRY-PAPER-3-PHYSICS

BSC-(H)-1-BIOCHEMISTRY-PAPER-V-INTRODUCTORY-BIOLOGY

BSC-(H)-1-BIOCHEMISTRY-PAPER-VI-(MATHEMATICS-AND-STATISTICS)

BSC-(H)-1-BOTANY-PAPER-1-(INTRODUCTION-TO-THE-PLANT-WORLD-AND-PHYCOLOGY)

BSC-(H)-1-BOTANY-PAPER-2-(MICRO-BIOLOGY-MYCOLOGY-PHYTOPATHOLOGY-AND-LICHENS)

BSC-(H)-1-BOTANY-PAPER-2-(MICRO-BIOLOGY-MYCOLOGY-PYOPATGOLOGY-AND-LICHENS)

BSC-(H)-1-BOTANY-PAPER-3-(CELL-AND-MOLECULAR-BIOLOGY)

BSC-(H)-1-BOTANY-PAPER-3-(CILL-AND-MOLECUAR-BIOLOGY)

BSC-(H)-1-BOTANY-PAPER-V-(ECONOMIC-BOTANY-AND-CROP-IMPROVEMENT)

BSC-(H)-1-BY-105-BIOLOGY

BSC-(H)-1-CH-103-CHEMISTRY

BSC-(H)-1-CHEMISTRY-PAPER-1-(INORGANIC-CHEMISTRY)

BSC-(H)-1-CHEMISTRY-PAPER-1-(INORGANIC-CHEMISTRY-1)

BSC-(H)-1-CHEMISTRY-PAPER-1-INORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-(H)-1-CHEMISTRY-PAPER-1-V-(MATHEMATICS-1)

BSC-(H)-1-CHEMISTRY-PAPER-2-(ORGANIC-CHEMISTRY)

BSC-(H)-1-CHEMISTRY-PAPER-3-(PHYSICAL-CHEMISTRY-1)

BSC-(H)-1-CHEMISTRY-PAPER-IV-(MATHEMATICS-1)

BSC-(H)-1-CHEMISTRY-PAPER-V-(PHYSICS-1)-1

BSC-(H)-1-CHEMISTRY-PAPER-V-(PHYSICS-1)

BSC-(H)-1-CHEMISTRY-PAPER-VI-(B)-(ENVIRONMENTAL-CHEMISTRY)-1

BSC-(H)-1-CHEMISTRY-PAPER-VI-(B)-(ENVIRONMENTAL-CHEMISTRY)

BSC-(H)-1-CHEMSTRY-PAPER-3-(PHYSICAL-CHEMISTRY-1)

BSC-(H)-1-ELECTRNIC-SCIENCE-PAPER-1-1-(I)-(MECHANICS-AND-STRENGTH-OF-MATERIALS)

BSC-(H)-1-ELECTRONECS-PAPER-1-6-(VI)-(MATHEMATICAL-PHYSICS-I)

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-1

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-2-(II)-(ELECTRICITY-AND-MAGNETISM)

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-2

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-3

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-4-(IV)-(SEMICONDUCTOR-AND-SOLID-STATE-DEVICCS)

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-4

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1-5-(V)-(NETWORK-ANALYSIS-AND-LINEAR-ACTIVE-CIRCUITS)

BSC-(H)-1-ELECTRONIC-SCIENCE-PAPER-1

BSC-(H)-1-ELECTRONICS-PAPER-1

BSC-(H)-1-ELECTRONICS-SCIENCE-PAPER-1-7-(VII)-(MATHEMATICAL-PHYSICS)

BSC-(H)-1-ELECTRONICS-SCIENCE-PAPER-1

BSC-(H)-1-ELECTRONOC-SCIENCE-PAPER-1-3-(III)-(THERMAL-PHYSCIS)

BSC-(H)-1-EXAM-ZOOLOGY-PAPER-1-(NON-CHORDATA)

BSC-(H)-1-EXAM-ZOOLOGY-PAPER-2-DEVELOPMENT-BIOLOGY-AND-HISTOLOGY

BSC-(H)-1-MATHEMATICE-UNIT-3-(ANALYSIS-1)

BSC-(H)-1-MATHEMATICE-UNIT-3-(ANALYSIS-I)

BSC-(H)-1-MATHEMATICS-PAPER-1-(DIFFERENTIAL-CALCULUS-AND-INTEGRAL-CALCULUS

BSC-(H)-1-MATHEMATICS-PAPER-2-(ANALYSIS-1)

BSC-(H)-1-MATHEMATICS-PAPER-2-(TRIGONOMETRY-AND-ALGEBRA

BSC-(H)-1-MATHEMATICS-PAPER-2-TRIGONOMETRY-AND-ALGEBRA-INCLUDING-MATRICES-AND-DIRRERENTIAL-EQUATIONS-10C4

BSC-(H)-1-MATHEMATICS-PAPER-3-(ALGEBRA-1)

BSC-(H)-1-MATHEMATICS-UNIT-(ALGEBRA-I)-1

BSC-(H)-1-MATHEMATICS-UNIT-(ALGEBRA-I)

BSC-(H)-1-MATHEMATICS-UNIT-1-(VECTOR-CALCULUS-AND-GEOMETRY)-(6731)

BSC-(H)-1-MATHEMATICS-UNIT-1-(VECTOR-CALCULUS-AND-GEOMETRY)

BSC-(H)-1-MATHEMATICS-UNIT-1-1

BSC-(H)-1-MATHEMATICS-UNIT-1

BSC-(H)-1-MATHEMATICS-UNIT-2-(ALGEBRA-1)-(6732)

BSC-(H)-1-MATHEMATICS-UNIT-2

BSC-(H)-1-MATHEMATICS-UNIT-3-1

BSC-(H)-1-MATHEMATICS-UNIT-3

BSC-(H)-1-MATHEMATICS-UNIT-IV-(ANALYSIS-2)-(6734)

BSC-(H)-1-MATHEMATICS-UNIT-IV-(ANALYSIS-2)-1

BSC-(H)-1-MATHEMATICS-UNIT-IV-(ANALYSIS-2)

BSC-(H)-1-MATHEMATICS-UNIT-IV-1

BSC-(H)-1-MATHEMATICS-UNIT-IV

BSC-(H)-1-MATHMATICS-PAPER-1-(CALCULUS)

BSC-(H)-1-MATHMATICS-PAPER-2-(ANALYSIS-1)

BSC-(H)-1-MATHMATICS-PAPER-3-(ALGEBRA-1)

BSC-(H)-1-MICROBIOLOGY-PAPER-1-(HISTORY-AND-SCOPE-OF-MICROBILOGY-AND-MICROBIAL-WORLD)

BSC-(H)-1-MICROBIOLOGY-PAPER-2-(BIOCHEMISTRY-AND-INSTRUMENTION)

BSC-(H)-1-MICROBIOLOGY-PAPER-2-(BIOCHEMISTRY-AND-INSTRUMINTATION)

BSC-(H)-1-MICROBIOLOGY-PAPER-3-(BACTERIOLOGY)-(2)

BSC-(H)-1-MICROBIOLOGY-PAPER-3-(BACTERIOLOGY)

BSC-(H)-1-MICROBIOLOGY-PAPER-IV-(CONCEPT-OF-GENETICS)

BSC-(H)-1-MICROBIOLOGY-PAPER-IV-(CONCEPTS-OF-GENETICS)

BSC-(H)-1-MICROBIOLOGY-PAPER-V-(BIOSTATICS-AND-INTRODUCTION-TO-COMPUTERS)

BSC-(H)-1-PAPER-2-CHEMISTRY-(ORGANIC-AND-PHYSICAL-CHEMISTRY)

BSC-(H)-1-PAPRER-2-CHEMISTRY-ORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-(H)-1-PH-101-PHYSICS

BSC-(H)-1-PHYSICS-PAPER-1-(MATHEMATICAL-PHYSICS-1)

BSC-(H)-1-PHYSICS-PAPER-1-PROPERTIES-OF-MATTER

BSC-(H)-1-PHYSICS-PAPER-2-(MECHANICS)

BSC-(H)-1-PHYSICS-PAPER-2-THERMAL-PHYSICS

BSC-(H)-1-PHYSICS-PAPER-3-(ELECTRICITY-AND-MAGNETISM)

BSC-(H)-1-PHYSICS-PAPER-IV-(MATHEMATICS-1)

BSC-(H)-1-PHYSICS-PAPER-V-(INORGANIC-ORGANIC-CHEMISTRY)

BSC-(H)-1-PHYSICS-PAPER-VI-(LINCAR-DIGITAL-CIRCUITS-AND-INSTRUMENTS)

BSC-(H)-1-SEM-ANTHROPOLOGY-PAPER-ANHT-103-ARCHAEOLOGICAL-ANTHROPOLOGY

BSC-(H)-1-SEM-COMPUTR-SC-PAPER-103-CALCULUS

BSC-(H)-1-SEM-MATHEMATICS-PAPER-1-3-(ALGEBRA-1)

BSC-(H)-1-SEM-PAPER-CHHT-204-ANALYTICAL-METHODS-IN-CHEMICAL-ANALYSIS

BSC-(H)-1-STATISTICS-PAPER-1-(MATHEMATICS-1)

BSC-(H)-1-STATISTICS-PAPER-1-A-221-(MATHEMATICS-1)

BSC-(H)-1-STATISTICS-PAPER-1-V-A-224-(PROBABILITY-THEORY-1)

BSC-(H)-1-STATISTICS-PAPER-2-A-222-(MATHEMATICS-2)

BSC-(H)-1-STATISTICS-PAPER-3-(MATHEMATICS-3)

BSC-(H)-1-STATISTICS-PAPER-3-A-223-(MATHEMATICS-3)

BSC-(H)-1-STATISTICS-PAPER-IV-(PROBABILITY-THOERY-1)

BSC-(H)-1-STATISTICS-PAPER-V-A-225-(STATISTICAL-METHODS-1)

BSC-(H)-1-STATISTICS-PAPER-VI-A-226-APPLIED-STATISTICS-1

BSC-(H)-1-V-NUMERICAL-ANALYSIS-(PHHT-414)-(6238)

BSC-(H)-1-ZOOLOGY-PAPER-1-(ANIMAL-DIVERSITY-I)

BSC-(H)-1-ZOOLOGY-PAPER-1-ANIMALS-DIVERSITY-1-(NON-CHORDATA)

BSC-(H)-1-ZOOLOGY-PAPER-2-(DEVELOPMENTAL-BIOLOGY)

BSC-(H)-2-ANTHROPOLOGY-PAPER-3-(ARCHACOLOGICA-ANTHROPOLOGY)

BSC-(H)-2-ANTHROPOLOGY-PAPER-3-(ARCHAEOLOGICAL-ANTHROPOLOGY)

BSC-(H)-2-ANTHROPOLOGY-PAPER-IV-(SOCIAL-INSTITUTIONS)

BSC-(H)-2-ANTHROPOLOGY-PAPER-V-(FUNDAMENTALS-OF-HUMAN-ORIGINS-AND-EVOLUTION)

BSC-(H)-2-ANTHROPOLOGY-PAPRE-IV-(SOCIAL-INSTITUTIONS)

BSC-(H)-2-BIOCHEMISTRY-PAPER-IX-(METABOLISM-OF-CARBANHYDRATE-AND-LIPIDS)

BSC-(H)-2-BIOCHEMISTRY-PAPER-IX-(METABOLISM-OF-CARBOHYDRATES-AND-LIPIDS)

BSC-(H)-2-BIOCHEMISTRY-PAPER-VI-(BIOCHEMICAL-ANDBIOPHYSICAL-TECHNIQUES)

BSC-(H)-2-BIOCHEMISTRY-PAPER-VII-(PROTEINS-EAZYMES-AND-CO-ENZYMES)

BSC-(H)-2-BIOCHEMISTRY-PAPER-VII-(PROTEINSENZYMES-AND-CO-ENZYMES)

BSC-(H)-2-BIOCHEMISTRY-PAPER-VIII-(HUMAM-PHYSIOLOGY-AND-ENDOCRINOLOG-(

BSC-(H)-2-BIOCHEMISTRY-PAPER-X-(METABLISM-OF-AMINO-ACIDS-JMUDEOTIDES-AND-PORPHYRINS)

BSC-(H)-2-BIOCHEMISTRY-PAPER-X-(METABOLISM-OF-AMINO-ACIDSNUCLEOTIDES-AND-PORPHYRINS)

BSC-(H)-2-BIOCHIMISTRY-PAPER-VI-(BIOCHEMICAL-AND-BIOPHYSICAL-TECHNIQUES)

BSC-(H)-2-BOTANY-PAPER-1-V-(ARCHEGONIATAE)

BSC-(H)-2-BOTANY-PAPER-3-PLANT-FUNCATIONS-AND-GENETICS

BSC-(H)-2-BOTANY-PAPER-IV-(ARCHEGONIATAE)

BSC-(H)-2-BOTANY-PAPER-IV-ECONOMICS-AND-APPLIED-BOITANY

BSC-(H)-2-BOTANY-PAPER-V-(ECONOMIC-BOTANY-AND-CROP-IMPROVEMENT)

BSC-(H)-2-BOTANY-PAPER-VI-(GENETICS-AND-BIOTECHNOLOGY)

BSC-(H)-2-BOYANY-PAPER-VI-(GENETICS-AND-BIOTECHNOLOGY)

BSC-(H)-2-CH-201-CHEMISTRY

BSC-(H)-2-CHEMISTRY-PAPER-1-X-(PHYSICAL-CHEMISTRY-2)

BSC-(H)-2-CHEMISTRY-PAPER-3-INORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-(H)-2-CHEMISTRY-PAPER-3-INORGANIC-AND-PHYSICS-CHEMISTRY

BSC-(H)-2-CHEMISTRY-PAPER-IX-(PHYSICAL-CHEMISTRY-2)

BSC-(H)-2-CHEMISTRY-PAPER-VII-(INORGANIC-CHEMISTRY-2)-1

BSC-(H)-2-CHEMISTRY-PAPER-VII-(INORGANIC-CHEMISTRY-2)

BSC-(H)-2-CHEMISTRY-PAPER-VIII-(ORGANIC-CHCMISTRY-2)

BSC-(H)-2-CHEMISTRY-PAPER-VIII-(ORGANIC-CHEMISTRY-2)

BSC-(H)-2-CHEMISTRY-PAPER-X-(MATHEATICS-II)

BSC-(H)-2-CHEMISTRY-PAPER-X-(MATHEMATICS-2)

BSC-(H)-2-CHEMISTRY-PAPER-XI-(PHYSICS-2)

BSC-(H)-2-CHEMISTRY-PAPER-XI-(PHYSICS-II)

BSC-(H)-2-CHEMISTRY-PAPER-XII-(A)-(COMPUTERS-AND-THEIR-APPLICATIONS-TO-CHEMISTRY)

BSC-(H)-2-CHEMISTRY-PAPER-XII-(A)-(COMPUTES-AND-THEIR-APPLICATIONS-TO-CHEMISTRY)

BSC-(H)-2-CHEMISTRY-PAPER-XII-(B)-(ENTREPRENEURSHIP-AND-SMALL-BUSINESS)

BSC-(H)-2-CHEMISTRY-PAPER-XII-(B)-(ENTREPRENURSHIP-AND-SMALL-BUSINESS)

BSC-(H)-2-CHEMISTRY-PART-2-INORGANIC-CHEMISTRY-II

BSC-(H)-2-EKECTRINIC-SCI-PAPER-2-5-(XII)-(MODERN-OPTICS-AND-OPTO-ELECTRONICS)

BSC-(H)-2-ELECTRONIC-SCI-PAPER-2-2-(IX)-(OPERATIONAL-AMPLIFIER-AND-ANALOG-COMPUTATION)

BSC-(H)-2-ELECTRONIC-SCI-PAPER-2-3-(X)-(DUGUTAL-ELECLRONICS)

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-1-(VIII)-(MODERN-PHYSIES-AND-QUANTUM-MECHANICS)

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-1

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-2

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-3

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-4-(XI

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-5-(XII)-(MODERN-OPTICS-AND-OPTO-ELECTRONICS)

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-6-(XIII)-MATHIMATICAL-PHYSIES-III)

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2-7-(XIV)-(NUMERICAL-ANALYSIS)

BSC-(H)-2-ELECTRONIC-SCIENCE-PAPER-2

BSC-(H)-2-ELECTRONICS-HUMAN-BEHAVIOUR-AT-WORK-(QUALIFYING)

BSC-(H)-2-ELECTRONICS-HUMAN-BEHAVIOUR-AT-WORK

BSC-(H)-2-ELECTRONICS-SCIENCE-PAPER-2

BSC-(H)-2-EXAM-ZOOLOGY-PAPER-3-(CHORDATA)

BSC-(H)-2-EXAM-ZOOLOGY-PAPER-IV-ANIMAL-PHYSIOLOGY

BSC-(H)-2-GEOLGY-PAPER-VI-(IGNEOUS-AND-METAMORPHIC-PETROLOGY)

BSC-(H)-2-GEOLOGY-COURSE-V-PALAEOMTOLOGY

BSC-(H)-2-GEOLOGY-PAPER-IV-(PRINCIPLES-OF-STRATIGRAPHU-AND-SEDIMENTATION)

BSC-(H)-2-MATHEMATICS-PAPER-3-ANALYTIC-GEOMETRY-OF-TWO-DIMENSIONS-AND-VECTORS

BSC-(H)-2-MATHEMATICS-PAPER-IV-(I)-MECHANICS

BSC-(H)-2-MATHEMATICS-PAPER-IV-(II)-STATISTICS

BSC-(H)-2-MATHEMATICS-PAPER-IV-(STATISTICS)

BSC-(H)-2-MATHEMATICS-PAPER-V-(ANALYSIS-2)

BSC-(H)-2-MATHEMATICS-PAPER-VI-CPP-PROGRAMMING-AND-NUMERICAL-METHODS

BSC-(H)-2-MATHEMATICS-PAPER-VII-(ALGEBRA-2)

BSC-(H)-2-MATHEMATICS-UNIT-IX-(ANALUSIS-3)-1

BSC-(H)-2-MATHEMATICS-UNIT-IX-(ANALUSIS-3)-2011

BSC-(H)-2-MATHEMATICS-UNIT-IX-(ANALUSIS-3)

BSC-(H)-2-MATHEMATICS-UNIT-IX

BSC-(H)-2-MATHEMATICS-UNIT-V-(ALGEBRA-2)-(6735)

BSC-(H)-2-MATHEMATICS-UNIT-V-(ALGEBRA-2)-1

BSC-(H)-2-MATHEMATICS-UNIT-V-(ALGEBRA-2)-2011

BSC-(H)-2-MATHEMATICS-UNIT-V-(ALGEBRA-2)

BSC-(H)-2-MATHEMATICS-UNIT-V-2-(MEEHANICS-I)-2011

BSC-(H)-2-MATHEMATICS-UNIT-V-2-(MEEHANICS-I)

BSC-(H)-2-MATHEMATICS-UNIT-V-2-MECHANICS-I

BSC-(H)-2-MATHEMATICS-UNIT-V-3-(NUMERICAL-ANALYSIS-AND-COMPUTER-(P)-RAMMING)-(6738)

BSC-(H)-2-MATHEMATICS-UNIT-V-3

BSC-(H)-2-MATHEMATICS-UNIT-V

BSC-(H)-2-MATHEMATICS-UNIT-VI-(DIFFERENTIAL-EQUATIONS-I)-(6736)

BSC-(H)-2-MATHEMATICS-UNIT-VI-(DIFFERNTIAL-EQUATIONS-1)

BSC-(H)-2-MATHEMATICS-UNIT-VI-(DIFFERNTIAL-EQUATIONS-I)-2011

BSC-(H)-2-MATHEMATICS-UNIT-VI-(DIFFERNTIAL-EQUATIONS-I)

BSC-(H)-2-MATHEMATICS-UNIT-VI

BSC-(H)-2-MATHEMATICS-UNIT-VII-(MEEHANICS-1)

BSC-(H)-2-MATHEMATICS-UNIT-X-(PROBILITY-AND-MATHEMATICAL-STATISTICS)-(6740)

BSC-(H)-2-MATHEMATICS-UNIT-X

BSC-(H)-2-MATHEMATICS-UNOT-V-3-(NUMERICAL-ANSLYSIS-AND-COMPUTER-(P)-RAMMING)-2011

BSC-(H)-2-MATHEMATICS-UNOT-V-3-(NUMERICAL-ANSLYSIS-AND-COMPUTER-(P)-RAMMING)

BSC-(H)-2-MATHEMATICS-UNOT-VIII-(NUMERICAL-ANSLYSIS-AND-COMPUTER-PROGRAMMING)

BSC-(H)-2-MATHEMATICS-UNOT-X-(PROBILITY-AND-MATHEMATICAL-STATISTICS)-1

BSC-(H)-2-MATHEMATICS-UNOT-X-(PROBILITY-AND-MATHEMATICAL-STATISTICS)-2011

BSC-(H)-2-MATHEMATICS-UNOT-X-(PROBILITY-AND-MATHEMATICAL-STATISTICS)

BSC-(H)-2-MATHEMSTICS-PAPER-V-(ANALYSIS)

BSC-(H)-2-MATHMATICS-PAPER-IV-(DIFFRENTIAL-EQUATIONS-AND-METHEMATICAL-MODELLING-1)

BSC-(H)-2-MICROBIOLOGY-PAPER-IX-(MICROBIAL-ECOLOGY)-1

BSC-(H)-2-MICROBIOLOGY-PAPER-IX-(MICROBIAL-ECOLOGY)

BSC-(H)-2-MICROBIOLOGY-PAPER-VI-(VIROLOGY)-1

BSC-(H)-2-MICROBIOLOGY-PAPER-VI-(VIROLOGY)

BSC-(H)-2-MICROBIOLOGY-PAPER-VII-(ALGAE-AND-FANGI)

BSC-(H)-2-MICROBIOLOGY-PAPER-VII-(ALGAE-AND-FUNGI)

BSC-(H)-2-MICROBIOLOGY-PAPER-VIII-(MICROBIAL-PHYSIOLOGY-AND-METABOLISM)

BSC-(H)-2-MICROBIOLOGY-PAPER-VIII-(MICROBIAL-PHYSIOLOGY-AND-MOTABOLISM)

BSC-(H)-2-MICROBIOLOGY-PAPER-X-(MICROBIAL-GENETIC-AND-MOLECULAR-BIOLOGY)

BSC-(H)-2-MIROBIOLOGY-PAPER-X-(MICROBIAL-GENETICS-AND-MOLECULAR-BIOLOGY)

BSC-(H)-2-PAPER-IV-CHEMISTRY-ORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-(H)-2-PHYSICS-PAPER-3-WAVES-AND-OSCILLACATION

BSC-(H)-2-PHYSICS-PAPER-IV-ELECTROMAGNETISM-AND-ATOMIC-PHYSICS

BSC-(H)-2-PHYSICS-PAPER-IX-(MATHEMATICAL-PHYSICS-2)

BSC-(H)-2-PHYSICS-PAPER-X-(THERMAL-PHYSICS)

BSC-(H)-2-PHYSICS-PAPER-XI-(VIBRATIONS-AND-WAVE-OPTICS)

BSC-(H)-2-PHYSICS-PAPER-XIII-(MATHEMATIES-II)

BSC-(H)-2-PHYSICS-PAPER-XIV-(COMPUTER-FUNDAMENTALS-AND-PROGRAMMING)

BSC-(H)-2-PHYSICS-PAPER-XV-(PHYSICS-LAD-II)

BSC-(H)-2-PHYSICS-PAPER-XVI-(DIGITAL-AND-COMPUTER-LAD)

BSC-(H)-2-SEM-COMPUTER-SCIENCE

BSC-(H)-2-STATISTICS-PAPER-1-X-(MATHEMATICS-1-V)

BSC-(H)-2-STATISTICS-PAPER-1-X-B-221-(MATHEMATICS-1-V)

BSC-(H)-2-STATISTICS-PAPER-X-(MATHENATICS-V)

BSC-(H)-2-STATISTICS-PAPER-X-B-222-(MATHEMATICS-V)

BSC-(H)-2-STATISTICS-PAPER-XI-(MATHEMATICS-VI)

BSC-(H)-2-STATISTICS-PAPER-XI-B-223-(MATHEMATICS-VI)

BSC-(H)-2-STATISTICS-PAPER-XII-(PROBABILITY-THOEORY-II)

BSC-(H)-2-STATISTICS-PAPER-XII-B-224-(PROBABILITY-THEORY-2)

BSC-(H)-2-STATISTICS-PAPER-XIII-(STATISTICAL-METHODS-2)

BSC-(H)-2-STATISTICS-PAPER-XIII-B-225-(STATISTICAL-METHODS-2)

BSC-(H)-2-STATISTICS-PAPER-XIV-(APPLIED-STATISTICS-2)

BSC-(H)-2-STATISTICS-PAPER-XIV-B-226-(APPLIED-STATISTICS-2)

BSC-(H)-2-STATISTICS-PAPER-XV-(SAPLING-THEORY-AND-METHODS)

BSC-(H)-2-STATISTICS-PAPER-XV-B-227-(SAMPLING-THEORY-AND-METHODS)

BSC-(H)-2-STATISTICS-PAPER-XVI-(COMPUTER-PROGRAMMING-IN-C-FORTRAN-90)

BSC-(H)-2-STATISTICS-PAPER-XVI-B-228-(COMPUTER-PROGRAMMING-IN-C-FORTRAN-90)

BSC-(H)-2-ZOOLKOGY-PAPER-IV-(BIOLOGICAL-CHEMISTRY-AND-IMMUNOLOGY)

BSC-(H)-2-ZOOLOGY-PAPER-3-ANIMAL-DIVERSITY-2-(CHORDATA)

BSC-(H)-2-ZOOLOGY-PAPER-IV-(PHYSIOLOGY-W-R-T-HUMAN)

BSC-(H)-2-ZOOLOGY-PAPER-V-(ECOLOGY-AND-ENVIRONMENTAL-MANAGEMINT)

BSC-(H)-2-ZOOLOGY-PAPER-VI-(CELL-BIOLOGY)

BSC-(H)-3-1-MATHEMATICS-AND-STATISTICS

BSC-(H)-3-ANTHROPOLOGY-PAPER-3-(THIBE-AND-PEASANTRY-IN-INDIA)

BSC-(H)-3-ANTHROPOLOGY-PAPER-IX-(HUMAN-ECOLOGY-SOCIO-CULTURAL-DIMENSIONS)

BSC-(H)-3-ANTHROPOLOGY-PAPER-VI-(HUMAN-GENCTICS)

BSC-(H)-3-ANTHROPOLOGY-PAPER-VII-(HUMAN-ECOLOGY-BIOLOGICAL-DIMENSIONS)

BSC-(H)-3-ANTHROPOLOGY-PAPER-VIII-(BIOLOGICAL-DIVERSTY-IN-HUYMAN-POPULATIONS)

BSC-(H)-3-ATATISTICS-PAPER-XXV-(ECONOMETRICS)

BSC-(H)-3-BIOCHEMISTRY-PAPER-XI-(MOLECULAR-BIOLOGY-1)

BSC-(H)-3-BIOCHEMISTRY-PAPER-XI-(MOLECULAR-BIOLOGY-I)

BSC-(H)-3-BIOCHEMISTRY-PAPER-XIII-(MEMBRANE-BIOCHEMISTRY-AND-BIOENERGETICS)

BSC-(H)-3-BIOCHEMISTRY-PAPER-XIII-MEMBRANE-BIOCHEMISTRY-AND-BIOENERGETICS

BSC-(H)-3-BIOCHEMISTRY-PAPER-XIV-(CELL-BIOLOGY)-1

BSC-(H)-3-BIOCHEMISTRY-PAPER-XIV-(CELL-BIOLOGY)

BSC-(H)-3-BIOCHEMISTRY-PAPER-XV-(IMMUNOLOGY)-1

BSC-(H)-3-BIOCHEMISTRY-PAPER-XV-(IMMUNOLOGY)

BSC-(H)-3-BOTANY-PAPER-1-X-(DEVELOPMENT-AND-FUNCTIONAL-PLANT-ANATOMY)

BSC-(H)-3-BOTANY-PAPER-IX-(DEVELOPMENTAL-AND-FUNCTIONAL-PLANT-ANATONY)

BSC-(H)-3-BOTANY-PAPER-VII-(PLANT-PHYSILOGY)

BSC-(H)-3-BOTANY-PAPER-VII-(PLANT-SYSTEMATICS-AND-PHYTOGEOGRAPHY)

BSC-(H)-3-BOTANY-PAPER-VII-(PLANT-SYSTEMATICS-AND-PHYTOGERHRAPHY)

BSC-(H)-3-BOTANY-PAPER-VIII-(PLANT-ECOLOGY-AND-ENCIRONMENTAL-MANAGEMENT)

BSC-(H)-3-BOTANY-PAPER-VIII-(PLANT-ECOLOGY-AND-ENVIRONMENTAL-MANAGEMENT)

BSC-(H)-3-BOTANY-PAPER-X-(DEVELOPMENT-AND-EXPERIMENTAL-EMBRYOLOGY-OF-ANGIOSPERMS)

BSC-(H)-3-BOTANY-PAPER-X-(DEVELOPMENTAL-AND-EXPERIMENTAL-ENBRYOLOGY-OF-ANGIOSPERMS)

BSC-(H)-3-BOTANY-PAPER-XI-(PLANT-PHYSIOLOGICAL-PROCESSES-GROWTH-AND-DEVELOPMENT)

BSC-(H)-3-BOTANY-PAPER-XII-(PLANT-METABOLISM)

BSC-(H)-3-CHEMISTRY-PAPER-XIII-(INORGANIC-CHEMISTRY-3)

BSC-(H)-3-CHEMISTRY-PAPER-XIII-(INORGANIC-CHEMISTRY-III)

BSC-(H)-3-CHEMISTRY-PAPER-XIV-(INORGANIC-CHEMISTRY-1-V)

BSC-(H)-3-CHEMISTRY-PAPER-XIV-1-NORGANIC-CHEMISTRY-IV)

BSC-(H)-3-CHEMISTRY-PAPER-XV-(ORGANIC-CHEMISTRY-3)

BSC-(H)-3-CHEMISTRY-PAPER-XV-(ORGANIC-CHEMISTRY-III)

BSC-(H)-3-CHEMISTRY-PAPER-XVI-(ORGAMIC-CHEMISTRY)

BSC-(H)-3-CHEMISTRY-PAPER-XVI-(ORGANIC-CHEMISTRY-1-V)

BSC-(H)-3-CHEMISTRY-PAPER-XVII-(PHYSICAL-CHEMISTRY-3)

BSC-(H)-3-CHEMISTRY-PAPER-XVIII-(PHYSICAL-CHEMISTRY-1-V)

BSC-(H)-3-CHEMISTRY-PAPER-XVIII-(PHYSICAL-CHEMISTRY-IV)

BSC-(H)-3-ELECTRONIC-SCIENCE-PAPER-3-2-(XVI)-(ENGINEERING-DRAWING)

BSC-(H)-3-ELECTRONIC-SCIENCE-PAPER-3-2-(XVI)-ENGINEERING-DRAWING

BSC-(H)-3-ELECTRONIC-SCIENCE-PAPER-3-3-(XVII)-(COMMUNICATION)

BSC-(H)-3-ELECTRONIC-SCIENCE-PAPER-3-3-(XVII)-COMMUNICATION

BSC-(H)-3-ELECTRONIC-SCIENCE-PAPER-3-5-(XIX)-(MATERIAL-SCIENCE-AND-1-C-TECHNOLOGY)

BSC-(H)-3-ELECTRONICS-PAPER-3-(XVIII)-(ELECTROMAGNETISM-AND-ANTENNAS)

BSC-(H)-3-ELECTRONICS-PAPER-3-1-(XV)-(MICROPROCESSORS-AND-MICRO-COMPUTER-TECHNOLOGY)

BSC-(H)-3-ELECTRONICS-PAPER-3-1-(XV)-MICROPRECESS-AND-MICRO-COMPUTER-TECHNOLOGY

BSC-(H)-3-ELECTRONICS-PAPER-3-4-(XVII)-ELECTROMAGNETISM-AND-ANTENNAS

BSC-(H)-3-ELECTRONICS-PAPER-3-6-(XX)-(ELECTRICAL-TECHNOLOGY-AND-ELECTRIAL-MACHINES)

BSC-(H)-3-ELECTRONICS-PAPER-3-6-(XX)-ELECTRICAL-TECHNOLOGY-AND-ELECTRICAL-MACHINES

BSC-(H)-3-ELECTRONICS-PAPER-3-7-(XXI)-(POWER-ELECTRONICS)

BSC-(H)-3-ELECTRONICS-PAPER-3-7-(XXI)-POWER-ELECTRONICS

BSC-(H)-3-ELECTRONICS-SCIENCE-PAPER-3-5-(XIX)-MATERIAL-SCIENCE-AND-LC-TECHNOLOGY

BSC-(H)-3-GEN-EXPRESSION-AND-RECOMBINANT-DNA-TECHNOLOGY

BSC-(H)-3-GEOLGY-PAPER-VII-(GEOLOGY-OF-INDIA)

BSC-(H)-3-GEOLOGY-PAPER-1-X-(ORE-GEOLOGY)

BSC-(H)-3-GEOLOGY-PAPER-VIII-(EARTH-RESOURCES-AND-THIER-MANAGEMENT)

BSC-(H)-3-GEOLOGY-PAPER-X-(PHOTOGEOLOGY-REMOTE-SENSING-AND-GIS)

BSC-(H)-3-GEOLOGY-PAPER-XI-(HYDROGEOLOGY-AND-ENGINEERING-GEOLOGY)

BSC-(H)-3-GEOLOGY-PAPER-XII-(I)-ENVIRONMENTAL-GEOLOGY

BSC-(H)-3-GEOLOGY-PAPER-XII-(II)-(GEOMORPHOLOGY)

BSC-(H)-3-GEOLOGY-PAPER-XII-(III)-(GEOPROSPEETING-AND-MININH)

BSC-(H)-3-GEOLOGY-PAPER-XII-(IV)-(ROCK-MEEHANISMS-AND-ROCK-ENGINEERING)

BSC-(H)-3-GEOLOGY-PAPER-XII-(V)-(APPLIED-PALAEONTOLOGY)

BSC-(H)-3-MATHEATICS-PAPER-XVI-(ANALYSIS-V)-2011

BSC-(H)-3-MATHEATICS-PAPER-XVI-(ANALYSIS-V)

BSC-(H)-3-MATHEMATICS-PAPER-1-X-(PROBABILITY-AND-STATISTICS)

BSC-(H)-3-MATHEMATICS-PAPER-VIII-(DIFFERENTIAL-EQUATIONS-AND-MATHEMATICAL-MODELING-2)

BSC-(H)-3-MATHEMATICS-PAPER-XI-(ANALYSIS-3)

BSC-(H)-3-MATHEMATICS-PAPER-XII-(II)-(DISCRETE-MATHEMATICS)

BSC-(H)-3-MATHEMATICS-PAPER-XII-(III)-MATHEMATICAL-FINANCE

BSC-(H)-3-MATHEMATICS-PAPER-XII-(IV)-(NUMBER-THEORY-AND-CRYPTOGRAPHY)

BSC-(H)-3-MATHEMATICS-PAPER-XII-(V)-(OPTIMIZATION)

BSC-(H)-3-MATHEMATICS-PAPER-XIV-(MECHANICS-2)-(6744)

BSC-(H)-3-MATHEMATICS-PAPER-XIV-(MEEHANICS-2)-2011

BSC-(H)-3-MATHEMATICS-PAPER-XIV-(MEEHANICS-II)

BSC-(H)-3-MATHEMATICS-PAPER-XIV

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(2)-2011

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(2)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(3)-(DISCRETE-MATHEMATICS)-2011

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(3)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(I)-(NUMBER-THEORY)-(6747)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(I)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(IV)-(INTEGRAL-TRANSFORMS-AND-BOUNDARY-VALUE-PROBLEMS)-(6750)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(IV)-(INTEGRAL-TRANSFRMS-AND-BOUNDARY-VALUE-PROBLEMS)-1FD2-DE

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(IV)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(V)

BSC-(H)-3-MATHEMATICS-PAPER-XV-2-AND-XV-3-(VI)

BSC-(H)-3-MATHEMATICS-PAPER-XVI

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(2)-(BOOLEAN-ALGEBRA)-(6748)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(2)-2011

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(2)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(3)-(DISCRETE-MATHEMATICS)-2011

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(3)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(I)-(NUMBER-THEORY)-(6747)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(I)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(II)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(III)-(DISCRETE-MATHEMATICS)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(IV)-(INTEGRAL-TRANSFORMS-AND-BOUNDARY-VALUE-PROBLEMS)-(6750)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(IV)-(INTEGRAL-TRANSFRMS-AND-BOUNDARY-VALUE-PROBLEMS)-1FD2-DE

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(IV)-(INTEGRAL-TRANSFRMS-AND-BOUNDARY-VALUE-PROBLEMS)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(IV)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(V)-(COMPUTER-MATHEMATLES)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(V)

BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(VI)

BSC-(H)-3-MATHEMATICS-PAPERXV-2-AND-XV-3-(I)-(NUMBER-THEORY)-2011

BSC-(H)-3-MATHEMATICS-PAPERXVII-AND-XVIII-(I)-(NUMBER-THEORY)-2011

BSC-(H)-3-MATHEMATICS-PAPERXVII-AND-XVIII-(I)-(NUMBER-THEORY)

BSC-(H)-3-MATHEMATICS-UNIT-12)-(ALGEBRA-3)-(6742)

BSC-(H)-3-MATHEMATICS-UNIT-12-(ALGEBRA-3)-2011

BSC-(H)-3-MATHEMATICS-UNIT-12-(ALGEBRA-III)

BSC-(H)-3-MATHEMATICS-UNIT-12

BSC-(H)-3-MATHEMATICS-UNIT-X-3-(ALGEBRA-IV)-(6743)

BSC-(H)-3-MATHEMATICS-UNIT-X-3-(ALGEBRA-IV)-2011

BSC-(H)-3-MATHEMATICS-UNIT-X-3

BSC-(H)-3-MATHEMATICS-UNIT-XI-(DIFFEREATIAL-EQUATIONS-2)-2011

BSC-(H)-3-MATHEMATICS-UNIT-XI-(DIFFEREATIAL-EQUATIONS-2)

BSC-(H)-3-MATHEMATICS-UNIT-XI-(DIFFERENTIAL-EQUATIONS-2)

BSC-(H)-3-MATHEMATICS-UNIT-XI

BSC-(H)-3-MATHEMATICS-UNIT-XIII-(ALGEBRA-IV)

BSC-(H)-3-MATHEMATICS-UNIT-XV-(ANALYSIS-1-V)

BSC-(H)-3-MATHEMATICS-UNIT-XV-(ANALYSIS-IV)-2011

BSC-(H)-3-MATHEMATICS-UNIT-XV

BSC-(H)-3-MATHEMATICS-X-(ALGEBRA-3)

BSC-(H)-3-MICROBIOLOGY-PAPER-XI-(IMMUNOLOGY)

BSC-(H)-3-MICROBIOLOGY-PAPER-XII-(MEDICAL-MICROBIOLOGY)

BSC-(H)-3-MICROBIOLOGY-PAPER-XIII-(PLNT-PATHOLOGY)

BSC-(H)-3-MICROBIOLOGY-PAPER-XIV-(APPLIED-MICROBIOLOGY)

BSC-(H)-3-MICROBIOLOGY-PAPER-XV-(RECOMBINANT-DAN-TECHNOLOGY-AND-BIOTECHNOLOGY)

BSC-(H)-3-PHYSICS-PAPER-XIX-(STATISTICAL-PHYSICS)

BSC-(H)-3-PHYSICS-PAPER-XVII-(MATHEMATICAL-PHYSICS-II)

BSC-(H)-3-PHYSICS-PAPER-XVIII-(ELECTROMAGNETIC-THORY)

BSC-(H)-3-PHYSICS-PAPER-XX-(PHYSICS-OF-MATIRIALS)

BSC-(H)-3-PHYSICS-PAPER-XXI-(ELECTRONIC-DEVECES-PHYSICS-AND-APPLICATIONS)

BSC-(H)-3-PHYSICS-PAPER-XXII-(I)-(MODERN-CHEMISTRY)

BSC-(H)-3-PHYSICS-PAPER-XXII-(II)-(BIO-PHYSICS)

BSC-(H)-3-PHYSICS-PAPER-XXII-(III)-(ECONOMICS)

BSC-(H)-3-PHYSICS-PAPER-XXIII-AND-XXIV-(PHYSICS-LAB-3-AND-IV)

BSC-(H)-3-SEM-COMPUTER-SC-PAPER-302-SYSTEM-SOFTWARES

BSC-(H)-3-STATISISTICS-PAPER-XIX-(STATISTICAL-INFERENCE-1)

BSC-(H)-3-STATISTICS-PAPER-XIX-C-221-(STATISTICAL-INFERENCE-1)

BSC-(H)-3-STATISTICS-PAPER-XX-(STATISTICAL-INTERNCE-II)

BSC-(H)-3-STATISTICS-PAPER-XX-C-222-(STATISTICAL-INFERENCE-2)

BSC-(H)-3-STATISTICS-PAPER-XXI-(LINCAR-MODELS)

BSC-(H)-3-STATISTICS-PAPER-XXI-C-223-(LINEAR-MODELS)

BSC-(H)-3-STATISTICS-PAPER-XXII-(DESIGN-OF-EXPERIMENTS)-1

BSC-(H)-3-STATISTICS-PAPER-XXII-(DESIGN-OF-EXPERIMENTS)

BSC-(H)-3-STATISTICS-PAPER-XXIII-(OPERATIONAL-RESEARCH)

BSC-(H)-3-STATISTICS-PAPER-XXIV-(STOCHASTIC-PEOCESSES)

BSC-(H)-3-STATISTICS-PAPER-XXIV-(STOCHASTIC-PROCESSES)

BSC-(H)-3-STATISTICS-PAPER-XXV-(ECONOMETRICS)

BSC-(H)-3-STATISTICS-PAPER-XXVI-BIOSTATISTICS-1

BSC-(H)-3-STATISTICS-PAPER-XXVI-BIOSTATISTICS

BSC-(H)-3-ZOOLOGY-PAPER-IX-(CELL-AND-MOLECULAR-BIOLOGY)

BSC-(H)-3-ZOOLOGY-PAPER-VII-(GENETICS-GENIMICS-AND-BIOTECHNOLOGY)

BSC-(H)-3-ZOOLOGY-PAPER-VIII-(EVOLUTON-AND-ZOOGEOGRAPHY)

BSC-(H)-3-ZOOLOGY-PAPER-X-(A)-(APPLIED-ENTOMOLOGY)

BSC-(H)-3-ZOOLOGY-PAPER-X-(B)-(REPRODUCTIVE-BIOLOGY-AND-AND-HUMAN-BEHAVIOUR)

BSC-(H)-3-ZOOLOGY-PAPER-X-C-(MEDICAL-ZOOLOGY)

BSC-(H)-3-ZOOLOGY-PAPR-VI-(PHYSIOLOGY-AND-FUNCTIONAL-HISTOLOGY)

BSC-(H)-ALLIED-COURSES-LINEAR-ALGEBRA-1706-SEM-3

BSC-(H)-ANALOG-ELECTRONICS

BSC-(H)-AND-(P)-MATHEMATICS-AND-STATISTICS-(MACT-303-SEM-3-ANDI-(5951)

BSC-(H)-ANTH-103-(ARCHAEOLOGICAL-ANTHROPOLOGY-SEM-1-(5883)

BSC-(H)-ANTH-514-(HUMAN-ECOLOGY-BIOLOGICAL-DIMENSIONS)-SEM-V-(5901)

BSC-(H)-ANTH-516-(HUMAN-ECOLOGY-SOCIAL-AND-CULTURAL-DIMENSIONS)-SEM-V-(5903)

BSC-(H)-ANTHROPLOLGY-BIOCHEMISTRY-BIOLOGICAL-SCIENCES-(CELL-BIOLOGY)

BSC-(H)-ANTHROPOLOGH-ANTH-102-(INTRODUCTION-TO-BIOLOGICAL-ATHROPOLOGY)-SEM-1-(5882)

BSC-(H)-ANTHROPOLOGY-(ANTH-204-ARCHAEOLOGICAL-ANTHROPOLOGY-2)-SEM-2

BSC-(H)-ANTHROPOLOGY-(ANTH-205-ANTHOPOLOGY-OF-KINSHIP)-SEM-2

BSC-(H)-ANTHROPOLOGY-(ANTH-206-BIOSTATICS-AND-DATA-ANALYSIS)-SEM-2

BSC-(H)-ANTHROPOLOGY-(ANTH-410-TRIBES-AND-PEASENT-OF-INDIA)-SEM-1-V

BSC-(H)-ANTHROPOLOGY-(ANTH-411-ANTHPOLOGY-OF-RELIGION-POLITICS-AND-ECONOMICS)-SEM-1-V

BSC-(H)-ANTHROPOLOGY-(ANTH-412-BIODIVERSITY-AND-INDIGENOUS-KNOWLODGE)-SEM-1-V

BSC-(H)-ANTHROPOLOGY-(ANTH-413-B-ANTHROPOLOGY-OF-INDIA)-SEM-1-V

BSC-(H)-ANTHROPOLOGY-(ANTH-608-FUNDAMENTALS-OF-HUMAN-ORIGINS-AND-EVOLUTION)-SEM-VI

BSC-(H)-ANTHROPOLOGY-(ANTH-619-GENOMIC-DIVERSITY-IN-HUMAN-POPULATIONS)-SEM-VI

BSC-(H)-ANTHROPOLOGY-(PART-3)-SEM-VI

BSC-(H)-ANTHROPOLOGY-1-SEM-PAPER-ANHT-101-(INTRODUCTION-TO-SOCIAL-ANTHROPOLOGY)

BSC-(H)-ANTHROPOLOGY-1-SEM-PAPER-ANHT-102-(INTRODUCTION-TO-BIOLOGICAL-ANTHROPOLOGY)

BSC-(H)-ANTHROPOLOGY-1-YR-PAPER-2-(INTRODUCTION-TO-SOCIAL-ANTHROPOLOGY)

BSC-(H)-ANTHROPOLOGY-3-SEM-PAPER-ANHT-307-(THEORIES-OF-CULTURE-AND-SOCIETY)

BSC-(H)-ANTHROPOLOGY-3-SEM-PAPER-ANHT-308-(HUMAN-GENETICS)

BSC-(H)-ANTHROPOLOGY-3-SEM-PAPER-ANHT-XI-PRIMATE-BIOLOGY

BSC-(H)-ANTHROPOLOGY-ANTH-515-(BIOLOGICAL-DIVERSITY-IN-HUMAN-POPULATIONS)-SEM-V-(5902)

BSC-(H)-ANTHROPOLOGY-FUNDAMENTALS-OF-SOCIAL-ANTHROPOLOGY-(DC-1-2)-SEM-1-(7757)

BSC-(H)-ANTHROPOLOGY-PART-2-HUMAN-GENETICS

BSC-(H)-APPLIED-STATISTIC

BSC-(H)-ARCHAELOGICAL-ANTHROPOLOGY-2-(ANTH-204)-2-5910

BSC-(H)-ATH-BOT-BIOCHEM-BIO-MED-MICRIBIOLOGY-ZOOLOGY-SEM-V-(6387)

BSC-(H)-BIO-CHEMISTRY-1-SEM-PAPER-BCHT-101-BIOMOLECULES

BSC-(H)-BIO-CHEMISTRY-1-SEM-PPAOER=BCHT-102-BIOPHYSICS

BSC-(H)-BIO-CHEMISTRY-2-SEM-PAPER-BCHT-203-BIOCHEMICAL-AND-BIO-PHYSICAL-TECHNIQUES

BSC-(H)-BIO-CHEMISTRY-3-SEM-PAPER-BCHT-304-PROTEINS-AND-ENZYMES

BSC-(H)-BIO-CHEMISTRY-3-SEM-PAPER-BCHT-305-METABOLISM-OF-CARBOHYDRATES-AND-LIPIDS

BSC-(H)-BIO-CHEMISTRY-BIOMOLECULES-(BCHT-101)-SEM-1-(6361)

BSC-(H)-BIO-CHEMISTRY-BIOPHYSIS-(BCHT-102)-SEM-1-(6363)

BSC-(H)-BIO-CHEMISTRY-MOLECULES-OF-LIFE-(DC-1-1)-SEM-1-(7766)

BSC-(H)-BIO-CHEMISTRY-PART-1-BIOMOLECULES

BSC-(H)-BIO-CHEMISTRY-PART-1-BIOPHYSICS

BSC-(H)-BIO-CHEMISTRY-PART-2-METABOLISM-OF-CARBOHYDRATES-AND-LIPIDS

BSC-(H)-BIO-CHEMISTRY-PART-2-PROTEINS-AND-ENZYMES

BSC-(H)-BIO-CHEMISTRY-PART-2-PROTEIOS-AND-EMZYMES

BSC-(H)-BIO-CHEMISTRY-PART-3-HORMONE-BIOCHEMISTRY-V

BSC-(H)-BIO-CHEMISTRY-PART-3-IMMUNOLOGY-V

BSC-(H)-BIO-CHEMISTRY-PART-3-MEMBRANE-BIOLOGY

BSC-(H)-BIO-CHEMISTRY-PROTEINS-AND-ENZYMES-(BCHT-304)-SEM-3-(6370)

BSC-(H)-BIOCHEMISTRY-BIOCHEMICAL-TECHNIQUES-BCHT-203-SEM-II

BSC-(H)-BIOCHEMISTRY-BIOENERGETICS-BCHT-406-SEM-IV

BSC-(H)-BIOCHEMISTRY-BOTANY-ZOOLOGY-BMS-CHEMISTRY-2-CHCT-402-SEM-II

BSC-(H)-BIOCHEMISTRY-HORMONE-BIOCHEMISTRY-(BCHT-509)-SEM-V-(6383)

BSC-(H)-BIOCHEMISTRY-IMMUNOLOGY-(BCHT-510)-SEM-V-(6385)

BSC-(H)-BIOCHEMISTRY-IMMUNOLOGY-2-BCHT-613-SEM-VI

BSC-(H)-BIOCHEMISTRY-MEMBRANE-BIOLOGY-(BCHT-508)-SEM-V-(6381)

BSC-(H)-BIOCHEMISTRY-METABOLISM-OF-AMINO-ACIDS-AND-NUCLEOTIDES-BCHT-407-SEM-IV

BSC-(H)-BIOCHEMISTRY-METABOLISM-OF-CARBOHYDRATES-AND-LIPIDS-(BCHT-305)-SEM-3-(6372)

BSC-(H)-BIOCHEMISTRY-MOLECULAR-PHYSIOLOGY-BCHT-611-SEM-VI

BSC-(H)-BIOCHEMISTRY-RECOMBINANT-DNA-TECHNOLOGY-BCHT-612-SEM-VI

BSC-(H)-BIOMEDICAL-SCIENCE-(DC-1-3)-PRINCIPLES-OF-GENETICS-(DC-1-3)-2-(7951)

BSC-(H)-BOOLEAN-ALGEBRA

BSC-(H)-BOTANY-1-BIODIVERSITY-1

BSC-(H)-BOTANY-1-SEM-PAPER-BTHT-101-BIODIVERSITY-1-(ALGAE-AND-MICROBIOLOGY)

BSC-(H)-BOTANY-2-SEM-PAPER-BTHT-202-BIODIVERSITY-2

BSC-(H)-BOTANY-2-SEM-PAPER-BTHT-203-BIODIVERSITY-3-ARCHEGONIATE

BSC-(H)-BOTANY-3-SEM-PAPER-BTHT-304-PLANT-RESOURCE-UTILISATION

BSC-(H)-BOTANY-3-YEAR-V-BIOINFORMATICS

BSC-(H)-BOTANY-BIOINFORMATICS-(LSPT-409)-SEM-V-(5959)

BSC-(H)-BOTANY-ENVIROMENTAL-MANAGEMENT-(BTHT-509)-SEM-V-(5958)

BSC-(H)-BOTANY-ENVIRONMENTAL-MANAGEMENT-V

BSC-(H)-BOTANY-PAPER-2-PLANT-STRUTURE

BSC-(H)-BOTANY-PART-3-PLANT-PHYSIOLOGY-V

BSC-(H)-BOTANY-PARTIII-PLANT-PHYSIOLOGY-(BTHT-508)-SEM-V-(5957)

BSC-(H)-BOTANY-PLANT-RESOURCE-UTILIZATION-III

BSC-(H)-BOTANY-PLANT-SYSTEMATICS-AND-EVOLUTION-(BTHT-507)-SEM-V-(5956)

BSC-(H)-BOTANY-SUBSIDIARY

BSC-(H)-BOTANY-V-PLANT-SYSTEMATICS-AND-EVOLUTION

BSC-(H)-BOTANY-ZOOLOGY-MICROBIOLOGY-BIO-CHEMISTRY-1-SEM-PAPER-CHCT-301-CHEMISTRY

BSC-(H)-BTHT-101-BIODIVERSITY-1-(ALGAE-AND-MICROBIOLOGY)-SEM-1-(5941)

BSC-(H)-CALCULUS-1-(DC-1-1)-SEM-1-(7846)

BSC-(H)-CHEMISTRY-(DC-1-2)-SEM-1-(7767)

BSC-(H)-CHEMISTRY-1-CHHT-102-ORGANIC-CHEMISTRY-SEM-1-(6006)

BSC-(H)-CHEMISTRY-1-MICROBIOLOGY-BOTANY-ZOOLOGY-BIO-CHEMISTRY-BIO-MEDICAL-CHEMISTRY-I

BSC-(H)-CHEMISTRY-1-SEM-PAPER-CHCP-101-PRACTICAL-CHEMISTRY-LAB

BSC-(H)-CHEMISTRY-3-SEM-PAPER-CHHT-305-INORGANIC-CHEMISTRE

BSC-(H)-CHEMISTRY-3-SEM-PAPER-CHHT-306-ORGANIC-CHEMISTRY-2

BSC-(H)-CHEMISTRY-3-SEM-PAPER-MACT-302-MATHEMATICS-1

BSC-(H)-CHEMISTRY-APPLICATION-OF-COMPUTERS-IN-CHEMISTRY-CHHT-618-SEM-VI

BSC-(H)-CHEMISTRY-CHHT-616-ORAGANIC-CHEMISTRY-V-SEM-VI

BSC-(H)-CHEMISTRY-GEOLOGY-PHCT-402-PHYSICS-2-SEM-IV

BSC-(H)-CHEMISTRY-IIISEM-PAPER-CHHT-307-PHYSICSL-CHEMISTRY-2

BSC-(H)-CHEMISTRY-INORGANIC-CHEMISTRY-CHHT-408-SEM-IV

BSC-(H)-CHEMISTRY-INORGANIC-CHEMISTRY-V-CHHT-615-SEM-VI

BSC-(H)-CHEMISTRY-MATHEMATHICS-1-(MACT0101)-SEM-1-(6007)

BSC-(H)-CHEMISTRY-MATHEMATHICS-2-CODE-MACT-302-SEM-3-(6013)

BSC-(H)-CHEMISTRY-ORAGANIC-CHEMISTRY-3-CHHT-409-SEM-IV

BSC-(H)-CHEMISTRY-PART-1-MATHEMATICS-1

BSC-(H)-CHEMISTRY-PART-2-MATHEMATICS-II

BSC-(H)-CHEMISTRY-PART-2-ORGANIC-CHEMISTRY-II

BSC-(H)-CHEMISTRY-PART-2-PHYSICAL-CHEMISTRY-II

BSC-(H)-CHEMISTRY-PART-3-BIOCHEMISTRY-AND-ENVIRONMENTAL-CHEMISTRY

BSC-(H)-CHEMISTRY-PART-3-INORGANIC-CHEMISTRY-IV

BSC-(H)-CHEMISTRY-PART-3-ORGANIC-CHEMISTRY-1-V

BSC-(H)-CHEMISTRY-PART-3-PHYSICAL-CHEMISTRY-1-V-CHHT-513-SEM-V-(6017)

BSC-(H)-CHEMISTRY-PART-3-PHYSICAL-CHEMISTRY-IV

BSC-(H)-CHEMISTRY-PART-ORGANIC-CHEMISTRY

BSC-(H)-CHEMISTRY-PHYSICAL-CHEMISTRY-1-SEM-II

BSC-(H)-CHEMISTRY-PHYSICAL-CHEMISTRY-3-CHHT-410-SEM-IV

BSC-(H)-CHEMISTRY-PHYSICAL-CHEMISTRY-V-CHHT-617-SEM-VI

BSC-(H)-CHEMISTRY-PHYSICS-1-PHCT-201-SEM-II

BSC-(H)-CHEMISTRYCHHT-512-ORGANIC-CHEMISTRY-1-V-SEM-V-(6016)

BSC-(H)-CHEMSTRY-JI-SEM-PAPER-PHCT-201-PHYSICS-1

BSC-(H)-CITIZENSHIP-IN-A-GLOLISING-WORLD-SEM-VI

BSC-(H)-COMP-SCIENCE-2-SEM-(OLD-COURSE)-PAPER-201-DATA-STRUCTURES

BSC-(H)-COMPUTE-SC-1-SEM-PAPER-CS101-PROGRAMMING-FUNDAMENTALS

BSC-(H)-COMPUTE-SC-1-SEM-PAPER-CS102-DISCRETE-STRUCTURES

BSC-(H)-COMPUTE-SC-1-SEM-PAPER-CS103-CALCULUS-1

BSC-(H)-COMPUTE-SC-1-SEM-PAPER-CS104-DIGITAL-ELECTRONICS

BSC-(H)-COMPUTER-SC-3-SEM-PAPER-303-ALGEBRA

BSC-(H)-COMPUTER-SC-3-SEM-PAPER-305-ORGANIZATIONAL-BEHAVIOUR

BSC-(H)-COMPUTER-SC-PART-2-DESIGN-AND-ANALYSIS-OF-ALGORITHMS

BSC-(H)-COMPUTER-SC-V-SEM-PAPER-503-MICROPRCESSORS

BSC-(H)-COMPUTER-SCI-VI-SEM-PAPER-603-COMPUTER-GRAPHICS

BSC-(H)-COMPUTER-SCI-VI-SEM-PAPER-605-(II)-MULTIMEDIA-APPLICATION

BSC-(H)-COMPUTER-SCIECNCE-IV-SEM-PAPER-402-SOFTWARE-ENGINEENING

BSC-(H)-COMPUTER-SCIENCE-(CSHT-306)-SYSTEM-PROGRAMMING-SEM-3-(6071)

BSC-(H)-COMPUTER-SCIENCE-(CSHT-513)-INTERNET-TECHNOLOGIES-SEM-V-(6077)

BSC-(H)-COMPUTER-SCIENCE-(H)-ELECTONICS-FUNDAMENTAL-OF-PROGRAMMING-SEM-1-3-(6065)

BSC-(H)-COMPUTER-SCIENCE-(II-SEM)-PAPER-202-COMPUTER-SYSTEM-ARCHITECTURE

BSC-(H)-COMPUTER-SCIENCE-1-CALCULUS-AND-MATRICES

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-101-PROGARAMMING-FUNDAMENTALS

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-101-PROGRAMMING-FUNDAMENTALS

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-102-DISCERTE-STRUCTURES

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-102-DISCRETE-STRUCTURES

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-103-CALCULUS-1

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-104-DIGITAL-ELECTRONICS-1

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-104-DIGITAL-ELECTRONICS

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-105-LANGUAGE-FORM-AND-FUNCTION-1

BSC-(H)-COMPUTER-SCIENCE-1-SEM-PAPER-105-LANGUAGE-FORM-AND-FUNCTION

BSC-(H)-COMPUTER-SCIENCE-2-SEM-PAPER-205-(II)-FINANCIAL-MANAGEMENT

BSC-(H)-COMPUTER-SCIENCE-2-SEM-PAPER-CS-204-PROBABILITY-1

BSC-(H)-COMPUTER-SCIENCE-2-SEM-PAPER-CS-204-PROBABILITY

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-301-ALGORITHMS

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-302-SYSTEM-SOFTWARE

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-302-SYSTEM-SOFTWARES

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-303-ALGEBRA

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-305-ORGANIZATIONAL-BEHAVIOUR

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-CS-301-ALGORITHMS

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-CS-303-ALGEBRA

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-CS-304-STATISTICS

BSC-(H)-COMPUTER-SCIENCE-3-SEM-PAPER-CS-305-ORGANIZATIONAL-BEHAVOOUR

BSC-(H)-COMPUTER-SCIENCE-CS-203-CALCULUS-2-SEM-2

BSC-(H)-COMPUTER-SCIENCE-DESIGN-AND-ANALYSIS-OF-ALGORITHMS-(CSHT-305)-SEM-3-(6070)

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-401-OPERATING-SYSTEMS-1

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-401-OPERATING-SYSTEMS

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-402-SOFTWARE-ENGINEERING

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-403-PROGRAMMING-PARADIGMS

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-404-DIFFERENTIAL-EQUATIONS

BSC-(H)-COMPUTER-SCIENCE-IV-SEM-PAPER-405-TECHNICAL-COMMUNICATION-(ENGLISH)

BSC-(H)-COMPUTER-SCIENCE-PART-1-DISCRETE-STRUCTURES

BSC-(H)-COMPUTER-SCIENCE-PART-2-DATABASE-SYSTEMS-III

BSC-(H)-COMPUTER-SCIENCE-PART-2-SYSTEM-PROGRAMMING-III

BSC-(H)-COMPUTER-SCIENCE-THEORY-OF-COMPUTATION-(CSHT-511)-SEM-V-(6075)

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-501-FILE-STRUCTURES-AND-DATABASE-SYSTEMS

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-501-NUMERICAL-ANALYSIS-AND-SCIENTIFIC-COMPUTING

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-501-FILE-STRUCTURES-AND-DATABASE-SYSTEMS

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-502-COMP-NETWORKS

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-502-COMPUTER-NETWORKS

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-503-MICROPROCESSORS

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-504-NUMERICAL-ANALYSIS-AND-SCIENTIFIC

BSC-(H)-COMPUTER-SCIENCE-V-SEM-PAPER-CS-505-ECO

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-601-THEORY-OF-COMPUTATION

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-601-THEORY-OF-COMPUTER

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-602-NETWORKS-PROGRAMMING-7-ADMINISTRATION

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-602-NETWORKS-PROGRAMMING-AND-ADMINISTRATION

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-604-OPERATIONAL-RESEARCH

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-605-(I)-ARTIFICIAL-INTELLIGENCE

BSC-(H)-COMPUTER-SCIENCE-VI-SEM-PAPER-605-(II)-MULTIMEDIA-APPLICATION

BSC-(H)-COMPUTER-SCINECE-1-MATHEMATICAL-SCIENCE-PHYSICAL-SCIENCES-1-CALCULUS

BSC-(H)-COPUTER-SC-3-SEM-PAPER-301-ALGORITHMS

BSC-(H)-COURSES-ECONOMICS-PAPER-1-(ECONOMIC-SYSTEMS-AND-MICRO-ECONOMIC-THEORY)

BSC-(H)-COURSES-ECONOMICS-PAPER-1-ECONOMICS-SYSTEMS-AND-MICRO-ECONOMIC-THEORY

BSC-(H)-COURSES-ECONOMICS-PAPER-2-(MACRO-ECONOMICS-ANALYSIS-AND-POLICY)

BSC-(H)-COURSES-ECONOMICS-PAPER-3-ECONOMIC-DEVELOPMENT-AND-PLANNING-IN-INDIA

BSC-(H)-COURSES-HISTORY-PAPER-(A)-HISTORY-OF-INDIA-UPTO-1000-A-D

BSC-(H)-COURSES-HISTORY-PAPER-(B)-HISTORY-OF-INDIA-1000-A-D-1707-A-D

BSC-(H)-COURSES-HISTORY-PAPER-1-(A)-HISTORY-OF-INDIA-UPTO-1000-A-D

BSC-(H)-COURSES-HISTORY-PAPER-1-(B)-HISTORY-OF-INDIA-1000-A-D-1701-A-D

BSC-(H)-COURSES-HISTORY-PAPER-2-HISTORY-OF-MODERN-INDIA-1707-1950

BSC-(H)-COURSES-HISTORY-PAPER-3-(A)-HISTORY-OF-GREAT-BRITAIN-1485-1914

BSC-(H)-COURSES-HISTORY-PAPER-3-(B)-HISTORY-OF-EUROPE-1815-1939

BSC-(H)-COURSES-POLITICAL-SCIENCE-PAPER-1-POLITICAL-THEORY

BSC-(H)-COURSES-POLITICAL-SCIENCE-PAPER-2-INDIAN-GOVERNMENT-AND-POLITICS

BSC-(H)-CREDIT-COURSE-3-READING-GANDHI

BSC-(H)-DELHI-ANCIENT-SEM-IV

BSC-(H)-DEVELOPMENTAL-BIOLOGY

BSC-(H)-EARTH-SYSTEM-SCIENCE

BSC-(H)-ELECTORNIC-SCIENCE-PAPER-2-7-XIY-NUMERICAL-ANALYSIS

BSC-(H)-ELECTRONCS-ANALONG-COMMUNICATION-(ELHT-502)-SEM-V-(6460)

BSC-(H)-ELECTRONICS-(ELHT-603-OPTION-AND-OPTICAL-ELECTRONIC)-SEM-VI

BSC-(H)-ELECTRONICS-(ELHT-604-ENGINEERING-MATHEMAICS)-SEM-VI

BSC-(H)-ELECTRONICS-1-ELECTRONICS-PRACTICALS-2

BSC-(H)-ELECTRONICS-2-MATHEMATICES-2-CODE-MAHT-305-SEM-3-(6454)

BSC-(H)-ELECTRONICS-2-SEM-PAPER-MAHT-204-MATHEMATICS-1

BSC-(H)-ELECTRONICS-3-SEM-PAPER-MATH-305-MATHEMATICS-2

BSC-(H)-ELECTRONICS-3-SEMESTER-COMPUTER-SCIENCE-1-SEMESTER

BSC-(H)-ELECTRONICS-COMPUTER-SCIENCE-III

BSC-(H)-ELECTRONICS-CS-2-(DATA-STRUCTURE)-SEM-IV

BSC-(H)-ELECTRONICS-ELECTRONICS-INSTRUMENTATION-V

BSC-(H)-ELECTRONICS-PART-1-APPLIED-QUANTUM-MECHANICS-I

BSC-(H)-ELECTRONICS-PART-1-ENGINEERING-MATERIALS-I

BSC-(H)-ELECTRONICS-PART-1-NETWORK-ANALYSIA

BSC-(H)-ELECTRONICS-PART-2-ANALOG-ELECTRONICS-1

BSC-(H)-ELECTRONICS-PART-2-ELECTRONICS-PRACTICAL-V

BSC-(H)-ELECTRONICS-PART-2-ELECTRONICS-PRACTICAL-VI

BSC-(H)-ELECTRONICS-PART-2-MATHEMATICS-II

BSC-(H)-ELECTRONICS-PART-3-ANALOG-COMMUNICATION

BSC-(H)-ELECTRONICS-PART-3-ELECTRONICS-PRACTICAL-X

BSC-(H)-ELECTRONICS-PART-3-MICROPROCESSORS-AND-MICROCONTROLLERS

BSC-(H)-ELECTRONICS-PART-3-SEM-V-(6458)

BSC-(H)-ELECTRONICS-PART-3-WAVE-PROPAGATION-AND-ANTENNA

BSC-(H)-ELECTRONICS-PRACTICAL-I

BSC-(H)-ELECTRONIES-ELHT-101-APPLIED-QUANTUM-MECHANICS-SEM-1-(6441)

BSC-(H)-ELECTRONIES-NETWORK-ANALYSIS-(ELHT-103)-SEM-1-(6444)

BSC-(H)-ENGINEERING-MATERIAL

BSC-(H)-ENGLISH-HIGHER

BSC-(H)-ENLISH-LOWER

BSC-(H)-ENVIRONMENTAL-ISSUES-IN-INDIA

BSC-(H)-GENETICS-AND-GENOMICS-1

BSC-(H)-GENETICS-AND-GENOMICS-2-VI-5985

BSC-(H)-GEOLOGY-(APPLIED-RIVER-SCEINCE-(ET-1)-SEM-VI

BSC-(H)-GEOLOGY-(ENVIRONMENTAL-GEOLOGY-(ET-2)-SEM-VI

BSC-(H)-GEOLOGY-(ET-4-INTRODUCTION-TO-GEOCHEMISTRY)-SEM-VI-1

BSC-(H)-GEOLOGY-(ET-4-INTRODUCTION-TO-GEOCHEMISTRY)-SEM-VI

BSC-(H)-GEOLOGY-(GEHT-203-PHYSICAL-CHEMISTRY)-SEM-2

BSC-(H)-GEOLOGY-(GEHT-402-ECONOMIC-GEOLOGY)-SEM-1-V

BSC-(H)-GEOLOGY-(GEHT-403-ENGINEERING-GEOLOGY)-SEM-1-V

BSC-(H)-GEOLOGY-(GEOLOGY-OF-INDIA-GEHT-401)-SEM-2

BSC-(H)-GEOLOGY-(INTRODUCTION-TO-PETROLEUM-GEOLOGY-(ET-5)-SEM-VI

BSC-(H)-GEOLOGY-(PALAENTOLOGY-GEHT-202)-SEM-2

BSC-(H)-GEOLOGY-(QUATERNARY-GEOLOGY-AND-PALAEOCLIMATE-(ET-6)-SEM-VI

BSC-(H)-GEOLOGY-1-SEM-PAPER-GEHT-103-GEOMORPHOLOGY-AND-PHOTOGEOLOGY

BSC-(H)-GEOLOGY-1-SEM-PAPER-GEHT-104-MATHEMATICS

BSC-(H)-GEOLOGY-2-SEM-PAPER-GEHT-206-PALAEONTOLOGY

BSC-(H)-GEOLOGY-3-SEM-PAPER-PHCT-402-PHYSICS-II

BSC-(H)-GEOLOGY-COMPUTER-APPLICATIONS-(GEHT-503)-SEM-V-(6173)

BSC-(H)-GEOLOGY-EXPLORATION-(ET-3)-SEM-VI

BSC-(H)-GEOLOGY-GEHT-103-GEOMORPHOLOGY-AND-PHOTOGEOLOGY-SEM-1-(6163)

BSC-(H)-GEOLOGY-GEHT-301-STRUCTURAL-GEOLOGY-SEM-3-(6166)

BSC-(H)-GEOLOGY-GEHT-404-PROBABILITY-AND-STATISTICS-SEM-1-V

BSC-(H)-GEOLOGY-GEHT-501-HYDROGEOLOGY-SEM-V-(6171)

BSC-(H)-GEOLOGY-GEHT-502-GEOPHYSICS-SEM-V-(6172)

BSC-(H)-GEOLOGY-HYDROGEOLOGY-V

BSC-(H)-GEOLOGY-IGNEOUS-PETROLOGY-(GEHT-302)-SEM-3-(6167)

BSC-(H)-GEOLOGY-INORGANIC-CHEMISTRY-(GEHT-504)-SEM-V-(6174)

BSC-(H)-GEOLOGY-MATHEMATICS-(GEHT-104)-SEM-1-(6164)

BSC-(H)-GEOLOGY-MATHEMATICS-I

BSC-(H)-GEOLOGY-METAMORPHIC-PETROLOGY-(GEHT-303)-SEM-3-(6168)

BSC-(H)-GEOLOGY-MINERALOGY-AND-CRYSTALLOGRAPHY-SEM-1-(6162)

BSC-(H)-GEOLOGY-PART-1-MINERALOGY-CRYSTALLOGRPHY-I

BSC-(H)-GEOLOGY-PART-2-IGNEOUS-PETROLOGY-III

BSC-(H)-GEOLOGY-PART-2-METAMORPHIC-PETROLOGY

BSC-(H)-GEOLOGY-PART-2-PHSICS-II

BSC-(H)-GEOLOGY-PART-3-COMPUTER-APPLICATIONS

BSC-(H)-GEOLOGY-PART-3-GEOPHYSICS-V

BSC-(H)-GEOLOGY-PART-3-V-INORGANIC-CHEMISTRY-I

BSC-(H)-GEOLOGY-PART-GEOMORPHOLOGY-AND-PHOTOGEOLOGY

BSC-(H)-GEOLOGY-PHYSICS-1-(GEHT-204)-SEM-2

BSC-(H)-GEOLOGY-PHYSICS-2-(GEHT-304)-SEM-3-(6169)

BSC-(H)-GEOLOGY-SEDIMENTOLOGY-GEHT-201)-SEM-2

BSC-(H)-GEOLOGY-SEM-1-PAPER-GEHT-101-EARTH-SYSTEM-SCIENCE

BSC-(H)-GEOLOGY-SEM-1-PAPER-GEHT-102-MINERALOGY-AND-CRYSTALLOGRAPHY

BSC-(H)-GEOLOGY-SEM-2-PAPER-CHHT-101-CHEMISTRY-1

BSC-(H)-GEOLOGY-SEM-2-PAPER-GEHT-205-SEDIMENTOLOGY

BSC-(H)-GEOLOGY-SEM-3-PAPER-GEHT-307-STRUCTURAL-GEOLOGY

BSC-(H)-GEOLOGY-SEM-3-PAPER-GEHT-308-IGNEOUS-PETROLOGY

BSC-(H)-GEOLOGY-SEM-3-PAPER-GEHT-309-METAMORPHIC-PETROLOGY

BSC-(H)-HINDI-HIGHER-QUALIFYING

BSC-(H)-HINDI-LOWER-QUALIFYING

BSC-(H)-HOME-SCIENCE-(DC-1-2)-SEM-1-(7836)

BSC-(H)-HOME-SCIENCE-HUMAN-DEVELOPMENT-

BSC-(H)-IN-ANTHROPOLOGY-FUNDAMENTALS-OF-ORIGINS-AND-EVOLUTION-(DC-1-3)-2-(7760)

BSC-(H)-IN-ANTHROPOLOGY-MFUNDAMENTALS-OF-ARCHAEOLOGICAL-ANTHROPOLOGY-(DC-1-4)-2-(7761)

BSC-(H)-IN-BOTANY-FUNDAMENTALS-OF-BIOCHEMISTRY-2-(7781)

BSC-(H)-IN-BOTANY-MYCOLOGY-AND-PHYTOPATHOLOGY-(DC-1-3)-2-(7780)

BSC-(H)-IN-CHEMISTRY-ORGANIC-ALIPHATIC-HYDROCARBONS-2-(7790)

BSC-(H)-IN-MICROBIOLOGY-(DC-1-3)-BIOCHEMISTRY-2-(7860)

BSC-(H)-IN-MICROBIOLOGY-(DC-1-4)-PHYCOLOGY-AND-MYCOLOGY-2-(7861)

BSC-(H)-IST-YEAR-INTRODUCTION-TO-BIOLOGICAL-ANTHROPOLOGY

BSC-(H)-MATH-(H)-HINDI-LANGUAGE-(HIGHER)-(QUALIFYING)-SEM-1-AND-3-(1844)

BSC-(H)-MATH-(H)-HINDI-LANGUAGE-(HIGHER)-(QUALIFYING)-SEM-1-ANDIII-(1844)

BSC-(H)-MATH-(QULIFYING-COURSE)-SANSKRIT-LANGUAGE-6811-SEM-1

BSC-(H)-MATH-2-DISCIPLINE-CENTERED-CONCURRENT-COURSE-(2009)

BSC-(H)-MATH-2-DISCIPLINE-CENTERED-CONCURRENT-COURSE-PSYCHOLOGY-FOR-LIVING-(2017)

BSC-(H)-MATH-2-DISCIPLINE-CENTERED-CONCURRENT-COUSRSE-PSYCHOLOGY-FOR-LIVING-(2018)

BSC-(H)-MATH-3-ENGLISH-QUALIFYING-(HIGHER)

BSC-(H)-MATH-3-ENGLISH-QUALIFYING-(LOWER)-(2)

BSC-(H)-MATH-3-ENGLISH-QUALIFYING-(LOWER)

BSC-(H)-MATH-AND-MATHEMATICAL-SCIENCE-ETHICS-IN-PUBLIC-DOMAIN-SEM-3-1-(1861)

BSC-(H)-MATH-BSC-(MATHEMATICAL-SCIENCE)-CITIZENSHIP-IN-A-GLOLISING-WORLD-SEM-VI-(PAR-2

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-READING-GANDHI-6836-3-1-1-1

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-READING-GANDHI-6836-3-1-1

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-READING-GANDHI-6836-3-1-1287

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-READING-GANDHI-6836-3-1-1289

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-THE-INDIVIDUAL-AND-SOCIETY-683

BSC-(H)-MATH-BSC-MATHEMATICAL-SCIENCE-THE-INDIVIDUAL-AND-SOCIETY

BSC-(H)-MATH-ENGLISH-HIGHER-(QUALIFYING)-SEM-IAND-3-(1833)

BSC-(H)-MATH-ENGLISH-HIGHER

BSC-(H)-MATH-ENGLISH-LOWER-(QUALIFYING)-SEM-IAND-3-(1834)

BSC-(H)-MATH-GEOGRAPHY-2-PRINCIPLES-OF-GEOGRAPHY-SEM-IV-(1895)

BSC-(H)-MATH-GEOGRAPHY-DISCIPLINE

BSC-(H)-MATH-HINDI-LANGUAGE-LITERATURE-AND-CULTURE

BSC-(H)-MATH-MATHEMATICAL-SCIENCE-(H)-GENDER-AND-SOCIETYSEM-3-1-(5823)

BSC-(H)-MATH-MATHEMATICAL-SCIENCE-6834-SEM-3-1

BSC-(H)-MATH-PART-1-ANALYSIS

BSC-(H)-MATH-PART-2-ALGEBRA-II

BSC-(H)-MATHEMATICAL-PHYSIC

BSC-(H)-MATHEMATICAL-SCIENCE-ETHICS-IN-PUBLIC-DOMAIN-6830-SEM-1-3-128

BSC-(H)-MATHEMATICAL-SCIENCE-ETHICS-IN-PUBLIC-DOMAIN-6830-SEM-1-3

BSC-(H)-MATHEMATICAL-SCIENCE-GENDER-AND-SOCIETY-6835-SEM-3-1-1275

BSC-(H)-MATHEMATICAL-SCIENCE-GENDER-AND-SOCIETY-6835-SEM-3-1-128C-DE

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-1-V-(1921)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1920)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1922)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1923)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1924)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1925)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1927)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1928)

BSC-(H)-MATHEMATICAL-SCIENCE-SEM-VI-(1929)

BSC-(H)-MATHEMATICAL-SCIENCES-PAPER-ECONOMICS

BSC-(H)-MATHEMATICAL-SCIENCES-PART-1-SEM-1-BASIC-STATSTICS-AND-PROBAILITY

BSC-(H)-MATHEMATICS-(CREDIT-COURSE-1)-FINANCIAL-MANAGEMENT

BSC-(H)-MATHEMATICS-(PART-I)-ALGEBRA-I

BSC-(H)-MATHEMATICS-(PART1)-CALCULUS-1

BSC-(H)-MATHEMATICS-1-3-3-ALGEBRA-2-SEM-3-(6613)

BSC-(H)-MATHEMATICS-1-ALGEBRA-1-SEM-1-(6604)

BSC-(H)-MATHEMATICS-1-CALCULUS-1-PAPER-CODE-MAHT-101-SEM-1-(6601)

BSC-(H)-MATHEMATICS-2-ANALYSIS-AND-STATISTICS-PHHT-413-SEM-IV

BSC-(H)-MATHEMATICS-3-ALGEBRA-IV-PAPER-5-3-SEM-V-(6619)

BSC-(H)-MATHEMATICS-ANALYSIS-1-CODE-MAHT-102-SEM-1-(6603)

BSC-(H)-MATHEMATICS-ANALYSIS-1-V-(5-2)-SEM-V-(6618)

BSC-(H)-MATHEMATICS-AND-STATISTICS

BSC-(H)-MATHEMATICS-B-A-(H)-HISTORY-1-A-CULTURSES-IN-INDIA-ANCIENT-DISCIPLINE-CENTRED

BSC-(H)-MATHEMATICS-CREDIT-COURSE-3-FINANCIAL-ACCOUNTING-SEM-IV

BSC-(H)-MATHEMATICS-DIFFERENTIAL-EQUATION-AND-MATHEMATICAL-MODELING-3-(PAPER-5-1)-SEM-V-(6616)

BSC-(H)-MATHEMATICS-DIFFERENTIAL-EQUATIONS-AND-MATHEMATICAL-MODELLING-1-SEM-II

BSC-(H)-MATHEMATICS-HINDI-LOWER-(QUALIFYING)-SEMIAND-3-(1845)

BSC-(H)-MATHEMATICS-IV-2-(ANALYSIS-III)-(MAHT-402)-SEM-IV

BSC-(H)-MATHEMATICS-LINEAR-PROGRAMMING-AND-THEORY-OF-GAMES-(PAPER-V-4)-SEM-V-(6620)

BSC-(H)-MATHEMATICS-MAHT-202-ANALYSIS-2-SEM-II

BSC-(H)-MATHEMATICS-MAHT-401-DIFFERENTIAL-EQUATIONS-AND-MATHEMATICAL-SEM-IV

BSC-(H)-MATHEMATICS-MAHT-403-ALGEBRA-3-SEM-IV

BSC-(H)-MATHEMATICS-MATHEMATICAL-SCIENCES-SEM-1-3-(5824)

BSC-(H)-MATHEMATICS-PART-2-3-1-CALCULUS-2-SEM-3-(6610)

BSC-(H)-MATHEMATICS-PART-2-CALCULUS-II

BSC-(H)-MATHEMATICS-PART-2-NUMERICAL-METHODS-AND-PROGRAMMING

BSC-(H)-MATHEMATICS-PROBABILITY-AND-STATISTICS-MAHT-203-SEM-II

BSC-(H)-MATHEMATICS-THE-INDIVIDUAL-AND-SOCIETY-SEM-3-1-(1864)

BSC-(H)-MATHS-(1987)

BSC-(H)-MATHS-(1988)

BSC-(H)-MATHS-B-A-(H)-HINDI-LITERATURE-SEM-IV

BSC-(H)-MATHS-BSC-MATHEMATICAL-SCIENCE-PHYSICS-I

BSC-(H)-MATHS-CULTURE

BSC-(H)-MICROBILOGY-(PART-III)-PLANT-PATHOLOGY

BSC-(H)-MICROBILOGY-BATANY-ZOOLOGY-BIO-CHEMISTRY-BIO-MEDICAL

BSC-(H)-MICROBILOGY-PART-3-IMMUNOLOGY

BSC-(H)-MICROBILOGY-PART-3-V-INDUSTRIAL-MICROBIOLOGY

BSC-(H)-MICROBILOLGY-PART-1-BACTERIOLOGY

BSC-(H)-MICROBIOLOG-PARTI-INTRODUCTION-TO-MICROBIAL-WORLD

BSC-(H)-MICROBIOLOGY-(PART-II)-304-VIROLOGY

BSC-(H)-MICROBIOLOGY-PART-1-BACTERIOLOGY-(MIHT-102)-SEM-1-(6512)

BSC-(H)-MICROBIOLOGY-PART-1-INTRODUCTION-TO-MICROBIAL-WORLD-(MIHT-101-SEM-1-(6510)

BSC-(H)-MICROBIOLOGY-PART-2-305-MICROBIAL-PHYSIOLOGY-AND-METABOLISM-I

BSC-(H)-MICROBIOLOGY-PART-2-MIHT-305-MICROBIAL-PHYSIOLOGY-AND-METABOLISM-1-SEM-3-(6521)

BSC-(H)-MICROBIOLOGY-PART-3-IMMUNOLOGY-(MIHT-509)-SEM-V-(6533)

BSC-(H)-MICROBIOLOGY-VIROLOGY-(MIHT-304)-SEM-3-(6519)

BSC-(H)-MICROBIOLOGYBOTNY-ZOOLOGY-BIO-CHEMISTRY-CHCT-301-CHEMISTRY-1-SEM-1-(5944)

BSC-(H)-MICROPROCESSOR-AND-COMPUTER-SCIENCE

BSC-(H)-MOLECULAR-BIOLOGY-I

BSC-(H)-PAPER-1-ATATISTICS-PAPER-2-(MATHEMATICS-2

BSC-(H)-PART-1-ANTH-101-(INTRODUCTION-TO-SOCIAL-ANTHROPOLOGY)-SEM-1-(5881)

BSC-(H)-PART-1-INTRODUCTION-TO-SOCIAL-ANTHROPOLOGY

BSC-(H)-PART-2-ANTH-307-(THEORIES-OF-CULTURE-AND-SOCIETY)-SEM-3-(5890)

BSC-(H)-PART-2-ANTH-308-(HUMAN-GENETICS)-SEM-3-(5891)

BSC-(H)-PART-2-ANTH-309-(PRIMATE-BIOLOGY)-SEM-3-(5892)

BSC-(H)-PART-2-SEMESTER-3-THEORIES-OF-CULTURE-AND-SOCIETY

BSC-(H)-PART-3-HUMAN-ECOLOGY-SOCIO-CULTURAL-DIMENSIONS

BSC-(H)-PHTSICS-1-SEM-PAPER-PHHP-PHYSICS-LAB-I

BSC-(H)-PHY-SC-LIFE-SCIENCE-(QUALIFYING-PAPER)-PAPER-ESQP-ENVIRONMENTAL-STUDIES

BSC-(H)-PHY-SC-LIFE-SCIENCE-SEM-2-PAPER-ENAT-201

BSC-(H)-PHY

BSC-(H)-PHYSICS-1-SEM-PAPER-CHCT-101-CHEMISTRY

BSC-(H)-PHYSICS-1-SEM-PAPER-PHHT-101-(MATHEMATICAL-PHYSICS)

BSC-(H)-PHYSICS-1-SEM-PAPER-PHHT-102-MECHANICS

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHP-206-DIGITAL-ELECTRONICS

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHP-PHYSICS-LAB-II

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHT-203-MATHEMATICAL-PHYSICS

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHT-204-OSCILLATIONS-AND-WAVES

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHT-205-ELECRICITY-AND-MAGNETISM

BSC-(H)-PHYSICS-2-SEM-PAPER-PHHT-206-DIGITAL-ELECTRONICS

BSC-(H)-PHYSICS-3-SEM-PAPER-310-(MATHEMATICS-1)

BSC-(H)-PHYSICS-3-SEM-PAPER-PHHP-308-MICROPROCESSOR-AND-CPMPUTER-LAB

BSC-(H)-PHYSICS-3-SEM-PAPER-PHHT-307-MATHEMATICAL-PHYSICS-3

BSC-(H)-PHYSICS-3-SEM-PAPER-PHHT-308-MICROPROCESSOR-AND-COMPUTER-PROGRAMMING

BSC-(H)-PHYSICS-3-SEM-PAPER-PHHT-309-(THERMAL-PHYSICS)

BSC-(H)-PHYSICS-3-SEM-PAPER-PHHT-PHYSICS-LAB-3-(LAB-THEORY)

BSC-(H)-PHYSICS-BSC-MATHEMATICS-PART-1-CONCURRENT-COURSE-I

BSC-(H)-PHYSICS-DIGITAL-ELECTRONICS-PHHT-206-SEM-II

BSC-(H)-PHYSICS-ELECTROMAGNETIC-THEORY-PHHT-619-SEM-VI

BSC-(H)-PHYSICS-ELECTRONIC-DEVICES-(PHHT-518)-SEM-V-(6218)

BSC-(H)-PHYSICS-MATHEMATICAL-PHYSICS-1-(PHHT-101)-SEM-1-(6201)

BSC-(H)-PHYSICS-MATHEMATICAL-PHYSICS-1-(PHHT-101)-SEM-1-(7876)

BSC-(H)-PHYSICS-MATHEMATICAL-PHYSICS-3-PHHT-307-SEM-3-(6207)

BSC-(H)-PHYSICS-MATHEMATICAL-PHYSICS-IV-PHHT-411-SEM-IV

BSC-(H)-PHYSICS-MECHANICS-(PHHT-102)-(DC-1-2)-SEM-1-(7877)

BSC-(H)-PHYSICS-MECHANICS-(PHHT-102)-SEM-1-(6202)

BSC-(H)-PHYSICS-NUCLEAR-AND-PARTICLE-PHYSICS-(PHHT-622)-SEM-VI

BSC-(H)-PHYSICS-OPTICS-PHHT-412-SEM-IV

BSC-(H)-PHYSICS-OSCILLATION-AND-WAVES-PHHT-204-SEMESTER-II

BSC-(H)-PHYSICS-PART-1-CHEMISTRY-LAB

BSC-(H)-PHYSICS-PART-1-DIGITAL-ELECTRONICS-PHHP-206-SEM-II

BSC-(H)-PHYSICS-PART-1-MATHEMATICAL-PHYSICS-I

BSC-(H)-PHYSICS-PART-1-MECHANICS-I

BSC-(H)-PHYSICS-PART-1-PHYSICS-LAB-I

BSC-(H)-PHYSICS-PART-2-MATHEMATICAL-PHYSICS-III

BSC-(H)-PHYSICS-PART-2-MATHEMATICS-I

BSC-(H)-PHYSICS-PART-2-MICROPROCCSOR-AND-COMPUTER-PROGRAMMING

BSC-(H)-PHYSICS-PART-2-MICROPROCESSOR-AND-COMPUTER-PROGRAMMING-P

BSC-(H)-PHYSICS-PART-2-NUMERICAL-ANALYSIS-LAB-PHHP-414-SEM-IV

BSC-(H)-PHYSICS-PART-2-PHHP-1-V-PHYSICS-LAB-1-V-SEM-IV

BSC-(H)-PHYSICS-PART-2-PHYSICS-LAB-3-LAB-THEORY

BSC-(H)-PHYSICS-PART-2-THERMAL-PHYSIES-III

BSC-(H)-PHYSICS-PART-3-ATOMIC-AND-MOLECULAR-PHYSICS

BSC-(H)-PHYSICS-PART-3-ELECTRONIC-DEVICES-V

BSC-(H)-PHYSICS-PART-3-MATHEMATICAL-PHYSICS-V

BSC-(H)-PHYSICS-PART-3-QUANTUM-MECHANICS-V

BSC-(H)-PHYSICS-PART-3-V-PHYSICS-LAB-VI

BSC-(H)-PHYSICS-PHHP-2-PHYSICS-LAB-2-SEM-II

BSC-(H)-PHYSICS-PHHT-203-MATHEMATICAL-PHYSICS-2-SEM-II

BSC-(H)-PHYSICS-PHHT-205-ELECTRICITY-AND-MAGNETISM-SEM-II

BSC-(H)-PHYSICS-QUANTUM-MECHANICS-(PHHT-516)-(H)-PHYSICS-SEM-V-(6216)

BSC-(H)-PHYSICS-QUANTUM-MECHANICS-(PHHT-516)-SEM-V-(6216)

BSC-(H)-PHYSICS-SOLID-STATE-PHYSICS-PHHT-621-SEM-VI

BSC-(H)-PHYSICS-STATISTICS-PHYSICS-PHHT-620-SEM-VI

BSC-(H)-PHYSICS-THERMAL-PHYSICS-(PHHT-309)-SEM-3-(6209)

BSC-(H)-PLANT-RESOURCE-UTILIZATION-(BTHT-304)-SEM-3-(5950)

BSC-(H)-PROG-2-SEM-PAPER-CSAT-201-COMPUTER-SCIENCE

BSC-(H)-PROG-CHEMISTRY-2-SEM-PAPER-LSPT-202

BSC-(H)-PROG-LIFE-SCS-1-V-SEM-PAPER-LSPT-408

BSC-(H)-SEDIMENTOLOGY-AND-PRINCIPLES-OF-STRATIGRAPHY-1580-SEM-3

BSC-(H)-SEM-1-MATHEMATICS-PAPER-1-1-(CALCULUS)

BSC-(H)-SEM-1-MATHEMATICS-PAPER-1-2-(ANALYSIS-1)

BSC-(H)-SEM-V-COMPUTER-SCIENCE-PAPER-501-FILE-STRUC-AND-DATABASE-SYSTEMS

BSC-(H)-SEM-V-COMPUTER-SCIENCE-PAPER-505-ECONOMICS

BSC-(H)-STATATISTICS

BSC-(H)-STATISTICS-ALGEBRA-2-STH-202-SEM-II

BSC-(H)-STATISTICS-CALCULUS-2-STHT-201-SEM-II

BSC-(H)-STATISTICS-FIRST-YEAR-STHT-104-PROBABILITY-AND-STATISTICAL-METHODS-1-SEM-1-(6699)

BSC-(H)-STATISTICS-PART-1-CALCULUS-I

BSC-(H)-STATISTICS-PART-2-APPLIED-STATISTRICS-II

BSC-(H)-STATISTICS-PART-2-PROBABILITY-AND-STATISTICAL-METHODS-III

BSC-(H)-STATISTICS-PART-2-REAL-ANALYSIS

BSC-(H)-STATISTICS-PART-2-SURVEY-SAMPLING-III

BSC-(H)-STATISTICS-PART-ALGEBRA-I

BSC-(H)-STATISTICS-PART-PROBABILITY-AND-STATISTICAL-METHODS-1

BSC-(H)-STATISTICS-PROBABLITY-AND-STATISTICS-METHODS-2-STH-203-SEM-II

BSC-(H)-STATISTICS-STHT-204-APPLIED-STATISTICS-1-SEM-II

BSC-(H)-STATISTICS-STHT-301-REAL-ANALYSIS-SEM-3-(6701)

BSC-(H)-STATISTICS-STHT-302-PROBABILITY-AND-STATISTICAL-METHODS-3-SEM-3-(6702)

BSC-(H)-STATISTICS-STHT-303-APPLIES-STATISTICS-2-SEM-3-(6703)

BSC-(H)-STATISTICS-STHT-401-NUMERICAL-ANALYSIS-SEM-IV

BSC-(H)-STATISTICS-STHT-402-PROBABILITY-AND-STATISTICAL-METHODS-1-V-SEM-IV

BSC-(H)-STATISTICS-STHT-403-OPERATION-RESEARCH-SEM-IV

BSC-(H)-TECHNICAL-WRITING-AND-COMMUNICATION-IN-ENGLISH

BSC-(H)-THE-INDIVIDUAL-AND-SOCIETY

BSC-(H)-V-SEM-COMPUTER-SC-PAPER-504-NUMERICAL-ANAKYSIS-AND-SCIENTFIC-COMPUTING

BSC-(H)-V-SEM-COMPUTER-SC-PAPER-505-ECONOMICS

BSC-(H)-ZOOLOGY-1-BIODIVERSITY-1-NON-CHORDATA

BSC-(H)-ZOOLOGY-1-ST-SEM-PAPER-2-ZOHT-101-BIODIVERSITY-1-BIODIVERSITTY-NON-CHORDATA

BSC-(H)-ZOOLOGY-2-SEM-PAPER-2-ZOHT-202-BIODIVERSITY-2-(CHORDATA-1)

BSC-(H)-ZOOLOGY-2-SEM-PAPER-2-ZOHT-203-BIODIVERSITY-3-CHORDATA-2

BSC-(H)-ZOOLOGY-3-SEM-PAPER-IX-ZOHT-304-ANIMAL-PHYSIOLOGY-AND-FUNCTIONAL-HOSTOLOGY-1

BSC-(H)-ZOOLOGY-ANIMAL-PHYSIOLOGY-AND-FUNCTIONAL-HISOLOGY-I

BSC-(H)-ZOOLOGY-BIODIVERSITY-1-(NON-CHORDATA)-(ZOHT-101)-SEM-1-(6282)

BSC-(H)-ZOOLOGY-ECOLOGY-ZOHT-508-SEM-V-(6302)

BSC-(H)-ZOOLOGY-IMMUNOLOGY-ZOHT-507-SEM-V-(6301)

BSC-(H)-ZOOLOGY-PAPER-2-DEVELOPMENT-BIOLOGY-AND-HISTOLOGY

BSC-(H)-ZOOLOGY-PART-3-DEVELOPMENTAL-BIOLOGY-V

BSC-(H)-ZOOLOGY-PART-3-ECOLOGY

BSC-(H)-ZOOLOGY-PART-3-IMMUNOLOGY

BSC-(H)-ZOOLOGY-PERSPECTIVE-IN-ECOLOGY-(DC-1-2)-SEM-1-(7896)

BSC-(H)-ZOOLOGY-ZOHT-304-FUNCTIONAL-HISTOLOGY-SEM-3-(6291)

BSC-(HONAS)-1-MATHEMATICS-PAPER-1-(CALCULUS)

BSC-(HONOURS)-2-MATHEMATICS-PAPER-IV-(I)-(MECHANICS)

BSC-(HONOURS)-CHEMISTRY-CHHT-514-BIOCHEMISTRY-AND-ENVIRONMENTAL-CHEMISTRY-SEM-V-(6018)

BSC-(HONOURS)-MICROBIOLOGH-PART-3-INDUSTRTRIAL-MICROBIOLOGY-(MIHT-510)-SEM-V-(6535)

BSC-(HONOURS)-PHYSICS-ATOMIC-AND-MOLECULAR-PHYSICS-(PHHT-517)-SEM-V-(6217)

BSC-(II)-MICROBIOLOGY-2-SEM-PAPER-MHIT-203-PHYCOLOGY-AND-MYCOLOGY

BSC-(INDUSTRIAL-CHEMISTRYANALYTICAL-CHEMISTRY)-PHYSICS-THEORY-(PHPT404)-SEM-V-(6956)

BSC-(LIFE-S-CIENCE)-1-SEM-PAPER-MACT-303-MATHEMATICS-AND-STATISTICS

BSC-(LIFE-SCIENCES)-DEVELOPMENTAL-BILOLGY-AND-PHYSIOLOGY-PLANTS-1261SEM-V

BSC-(LIFE-SCIENCES)-V-DEVELOPMENTAL-BIOLOGY-AND-PHYSIOLOGY-PLANTS

BSC-(MATH-SCIENCES)-STATISTICS-STATISTICAL-METHOD-2-SEM-3-(5012)

BSC-(MATHEMATICAL-SCIENCES)-1-BASIC-AND-PROBABILITY-SEM-1-3-(5002)

BSC-(MATHEMATICAL-SCIENCES)-2-PSYCHOLOGY-OF-LIVING-SEM-V-(1869)

BSC-(MATHEMATICAL-SCIENCES)-3-STATISTICAL-METHODS-2

BSC-(MATHEMATICAL-SCIENCES)-MATHEMATICAL-PROGRAMMING

BSC-(MATHEMATICAL-SCIENCES)-OPERATIONAL-RESEARCH-CONCURRENT-OPERATIONAL-RESEARCH

BSC-(MATHEMATICAL-SCIENCES)-PART-I01-BASIC-AND-PROBABILITY-SEM-1-3-(5002)

BSC-(MATHEMATICAL-SCIENCES)-PRINCIPLES-OF-ECONOMICS-SEM-V-(6641)

BSC-(MATHEMATICAL-SCIENCES)-STATISTICS-DESCRIPTIVE-STATSTICS-AND-PROBABILITY

BSC-(MATHEMATICAL-SCIENCES)-STATISTICS-STP-505-STATISTICAL-INFERENCE-SEM-V-(5021)

BSC-(MATHEMATICAL-SCIENCS)-STATISTICS-DESCRIPTIVE-STATISTICS-AND-PROBABILITY-(STP-101)-SEM-1-(5001)

BSC-(P)-(H)-PHYSICAL-SCIENCES-1-SEM-PAPER-LSPT-101-BIOLOGY-INTRODUCTION-TO-BIOLOGY

BSC-(P)-(PHYSICAL-SC-LIFE-SC-APPLIED-SC)-CHPT-303-CHEMISTRY-3-SEM-1-(6810)

BSC-(P)-1-HU-112-TECHNICAL-WRITING-AND-COMMUNICATION-IN-ENGLISH

BSC-(P)-1-MA-107-(A)-MATHEMATICS-1-(FOR-PHYSICAL-SCIENCES)

BSC-(P)-1-MA-107-(A)-MATHEMATICS-1

BSC-(P)-2-AC-201-BASIC-PRICIPLES-AND-LAB

BSC-(P)-2-AC-201-BASIC-PRINCIPLES-AND-LAB-OPERATIONS-1

BSC-(P)-2-AC-201-BASIC-PRINCIPLES-AND-LAB-OPERATIONS

BSC-(P)-2-AC-202-QUANTITATIVE-METHODS-OF-ANALYSIS-1

BSC-(P)-2-AC-202-QUANTITATIVE-METHODS-OF-ANALYSIS

BSC-(P)-2-ACP-201-AGRICULTURAL-BOTANY-PLANT-PATHOLOGY-AND-WEEDS-1

BSC-(P)-2-ACP-201-AGRICULTURAL-BOTANY-PLANT-PATHOLOGY-AND-WEEDS

BSC-(P)-2-ACP-202-FERTILIZERS-HERBICIDES-FUNGICIDES

BSC-(P)-2-ACP-202-FERTUKUZERS-HERBICIDES-FUNGICIDES

BSC-(P)-2-BIO-201-BIOLOGY-OF-ANIMALS-FORM-STRUCTURE-AND-FUNCTION-1

BSC-(P)-2-BIO-201-BIOLOGY-OF-ANIMALS-FORM-STRUCTURE-AND-FUNCTION

BSC-(P)-2-BIO-202-BIOLOGY-AND-PLANTS-FORM-STRUCTURE-AND-FUNCTION

BSC-(P)-2-BIO-202-BIOLOGY-OF-PLANTS-FORM-STRUCTURE-AND-FUNCTION

BSC-(P)-2-BIO-202-BIOLOGY-OF-PLANTS-FORM

BSC-(P)-2-CH-201-CHEMISTRY-(ADMISSIONS-OF-07-AND-BEFORE)

BSC-(P)-2-CH-201-INORGANIC-CHEMISTRY-1

BSC-(P)-2-CH-201-INORGANIC-CHEMISTRY

BSC-(P)-2-CH-202-ORGANIC-CHEMISTRY-1

BSC-(P)-2-CH-202-ORGANIC-CHEMISTRY

BSC-(P)-2-CH-203-PHYSICAL-CHEMISTRY-1

BSC-(P)-2-CH-203-PHYSICAL-CHEMISTRY

BSC-(P)-2-CH-302-CHEMISTRY

BSC-(P)-2-COMPUTER-SCIENCE-PAPER-2-CS-202-COMPUTER-SYSTEM-ARCHITECTURE

BSC-(P)-2-COMPUTER-SCIENCE-PAPER-CS-202-COMPUTER-SYSTEM-ARCHITECTURE

BSC-(P)-2-COMPUTER-SCIENCE-PAPER-CS-202-COMPUTER-SYSTEN-ARCHITECTURE

BSC-(P)-2-CS-201-PROGRAMMING-AND-DATA-STRUCTURE

BSC-(P)-2-EL-201-(I)-ECONOMICS

BSC-(P)-2-EL-201-ANALOG-AND-DIGITAL-CIRCUITS-1

BSC-(P)-2-EL-201-ANALOG-AND-DIGITAL-CIRCUITS

BSC-(P)-2-EL-201-ANALOG-AND-DIGITAL-DIRCUITS

BSC-(P)-2-EL-202-SEMICONDUCTOR-DEVICES-AND-FABRICATION-1

BSC-(P)-2-EL-202-SEMICONDUCTOR-DEVICES-AND-FABRICATION

BSC-(P)-2-EL-210-(II)-ENTREPRENEURSHIP-1

BSC-(P)-2-EL-210-(II)-ENTREPRENEURSHIP

BSC-(P)-2-EL-210-(III)-ORGANISATIONAL-BEHAVIOUR-(NC)

BSC-(P)-2-EL-210-(III)-ORGANISTIONAL-BEHAVIOUR

BSC-(P)-2-EL-210-(IV)-PSYCHOLOGY

BSC-(P)-2-EL-210-(V)-FINANCIAL-ACCOUNTING-1

BSC-(P)-2-EL-210-(V)-FINANCIAL-ACCOUNTING

BSC-(P)-2-EL-210-(VI)-FINANCIAL-MANAGEMENT-1

BSC-(P)-2-EL-210-(VI)-FINANCIAL-MANAGEMENT

BSC-(P)-2-ES-201-CONCEPTS-IN-ECOLOGY

BSC-(P)-2-ES-202-NATURAL-RESOURCE-MANAGEMENT-1

BSC-(P)-2-ES-202-NATURAL-RESOURCE-MANAGEMENT

BSC-(P)-2-IC-201-INDUSTIAL-CHAMICALS-AND-ENVIRONMENT

BSC-(P)-2-IC-201-INDUSTRIAL-CHEMICALS-AND-ENVIRONMENT-1

BSC-(P)-2-IC-201-INDUSTRIAL-CHEMICALS-AND-ENVIRONMENT

BSC-(P)-2-IC-202-FOSSIL-FUELS-AND-FERMENTATION-INDUSTRIES-1

BSC-(P)-2-IC-202-FOSSIL-FUELS-AND-FERMENTATION-INDUSTRIES

BSC-(P)-2-LS-201-BIODIVERSITY-1-PLANTS

BSC-(P)-2-LS-201-BIODIVERSITY-PLANTS

BSC-(P)-2-LS-202-BIODIVERSITY-2-(ANIMALS)-1

BSC-(P)-2-LS-202-BIODIVERSITY-2-(ANIMALS)

BSC-(P)-2-LS-203-CELL-BIOLOGY-BIOCHEMISTRY-AND-IMMUNOLOGY-2

BSC-(P)-2-LS-203-CELL-BIOLOGY-BIOCHEMISTRY-AND-IMMUNOLOGY-SEM-2

BSC-(P)-2-LS-203-CELL-BIOLOGY-BIOCHEMISTRY-AND-IMMUNOLOGY

BSC-(P)-2-LS-204-GENETICS-AND-MOLECULAR-BIOLOGY

BSC-(P)-2-LS-204-GENETICS-GENOMICS-AND-MOLECULAR-BIOLOGY-1

BSC-(P)-2-LS-204-GENETICS-GENOMICS-AND-MOLECULAR-BIOLOGY

BSC-(P)-2-MA-201-MATHEMATICS-1-(CALCULUS-AND-GEOMETRY)-(PHYSICAL-SCIENCES-APPLIED-SCIENCES)

BSC-(P)-2-MA-201-MATHEMATICS-1-(CALCULUS-AND-GEOMETRY)

BSC-(P)-2-MA-201-MATHEMATICS-1

BSC-(P)-2-MA-202-MATHEMATICS-(ALGEBRA-AND-DIFFERENTIAL-EQUATIONS)

BSC-(P)-2-MA-202-MATHEMATICS-2-ALGEBRA-AND-DIFFERENTIAL-EQUATIONS

BSC-(P)-2-MA-202-MATHEMATICS-2-ALGEBRA

BSC-(P)-2-MP-202-THERMAL-PHYSICS-AND-ELECROMAGNETISM

BSC-(P)-2-MP-202-THERMAL-PHYSICS-AND-ELECTROMAGNETISM

BSC-(P)-2-OPERATIONAL-RESEARCH-PAPER-OR-201-OPTIMIZATION-1

BSC-(P)-2-OPERATIONAL-RESEARCH-PAPER-OR-201-OPTIMIZATION

BSC-(P)-2-OPERATIONAL-RESEARCH-PAPER-OR-2020-INVENTORY-MANAGEMENT-AND-QUEUEING-THEORY

BSC-(P)-2-OPERATOINAL-RESEARCH-PAPER-OR-202-INVENTORY-MNGMNT-AND-QUEUEING-THEORY

BSC-(P)-2-OPRATIONAL-RESEARCH-OR-202-1-NVENTORY-MANAGEMENT-AND-QUEUING-THEORY

BSC-(P)-2-PAPER-CH-202-CHEMISTRY

BSC-(P)-2-PAPER-CH-202-CHEMISTRYV2

BSC-(P)-2-PAPER-CS-201-PROGRAMMING-AND-DATA-STRUCTURE-1

BSC-(P)-2-PAPER-CS-201-PROGRAMMING-AND-DATA-STRUCTURE

BSC-(P)-2-PH-201-PHYSICS-(ELECTRICITY-MAGNETISM-AND-ELECTROMAGNETIC-THEORY)-1

BSC-(P)-2-PH-201-PHYSICS-(ELECTRICITY-MAGNETISM-AND-ELECTROMAGNETIC-THEORY)

BSC-(P)-2-PH-201-PHYSICS-(MATHEMATICAL-PHYSICS)

BSC-(P)-2-PH-202-PHYSIC-THERMAL-PHYSICS

BSC-(P)-2-PH-202-PHYSICS-(THEMAL-PHUSICS-AND-OPTICS)

BSC-(P)-2-PH-202-PHYSICS-THERMAL-PHYSICS-AND-OPTICS

BSC-(P)-3-AC-301-SEPARATION-METHODS-IN-ANALYTICAL-CHEMISTRY

BSC-(P)-3-AC-302-INSTRUMENTAL-METHODS-OF-ANALYSIS

BSC-(P)-3-ACP-301-APPLIED-ENTOMOLIGY

BSC-(P)-3-ACP-301-APPLIED-ENTOMOLOGY

BSC-(P)-3-ACP-302-INSECTICIDE-PESITICIDE-FORMULATION-ANALYSIS-QUALITY-CONTROL

BSC-(P)-3-ACP-302-INSECTICIDE-PESTICIDE-FORMULATION-ANALYSIS-QUALITY-CONTROL

BSC-(P)-3-BIO-302-GENETICS-BIOTECHNOLOGY-AND-IMMUNOLOGY

BSC-(P)-3-C-302-POLYMERS-AND-INSTRUMENTAL-MATHODS-AND-ANALYSIS

BSC-(P)-3-CH-301-CHEMISTRY-(ADMISSIONS-OF-07-AND-BEFORE)

BSC-(P)-3-CH-301-INORGANIC-CHEMISTRY

BSC-(P)-3-CH-302-CHEMISTRY-(OC-ADMISSIONS-OF-07-AND-BEFORE)

BSC-(P)-3-CH-302-ORGANIC-CHEMISTRY

BSC-(P)-3-CH-303-PHYSICAL-CHEMISTRY

BSC-(P)-3-CS-301-OPERATING-SYSTEM-AND-NETWORKS-ADMISSI0NS-OF-05

BSC-(P)-3-CS-301-OPERATING-SYSTEMS-AND-NETWORKS

BSC-(P)-3-CS-302-SOFTWARE-ENGINEERING-AND-DATABASES

BSC-(P)-3-CS-302-SOFTWATE-ENGINEERING-AND-DATABASES

BSC-(P)-3-EL-301-ELECTRONICS-COMMUNICATIONS-1

BSC-(P)-3-EL-301-ELECTRONICS-COMMUNICATIONS

BSC-(P)-3-EL-302-MICROPROCESSORS-AND-MICRO-CONTRALLERS

BSC-(P)-3-EL-302-MICROPROCESSORS-AND-MICRO-CONTROLLERS

BSC-(P)-3-EL-310-(I)-GREEN-CHAMISTRY

BSC-(P)-3-EL-310-(I)-GREEN-CHEMISTRY

BSC-(P)-3-EL-310-(III)-BIOTECHNOLOGY-(ADMISSIONS-OF-05-AND-ONWARDS)

BSC-(P)-3-EL-310-(III)-BIOTECHNOLOGY

BSC-(P)-3-EL-310-(IV)-FORENSIC-SCIENCE

BSC-(P)-3-EL-310-(IV)-INTELLECTUAL-PROPERTY-RIGHTS

BSC-(P)-3-EL-310-(VII)-COMPUTATIONAL-AND-DISCRETE-MATHEMATICS

BSC-(P)-3-EL-310-(VII)-COMPUTATUINAL-AND-DISCRETE-MATHEMATICS

BSC-(P)-3-EL-310-(VIII)-MATHEMATICAL-METHODS-IN-LIFE-SCIENCES

BSC-(P)-3-EL-310-(VIII)-MATHEMATICAL-METHODS

BSC-(P)-3-ES-302-ENVIRINMENTAL-PROTECTION-AND-MANAGEMENT

BSC-(P)-3-ES-302-ENVIRONMENTAL-PROTECTION-AND-MANAGEMENT

BSC-(P)-3-IC-301-INDUSTRIAL-CHEMICALS-IN-AGRICULTURE-AND-MEDICINE-1

BSC-(P)-3-IC-301-INDUSTRIAL-CHEMICALS-IN-AGRICULTURE-AND-MEDICINE

BSC-(P)-3-IC-302-OIKYNER-AND-INSTRUMENTAL-METHODS-OF-ANALYSIS

BSC-(P)-3-LS-301-DEVEKIONEBTAL-BUILOGY-AND-PHYSIOLOGY

BSC-(P)-3-LS-301-DEVILOPMENTAL-BIOLOGY-AND-PHYSIOLOGY-PLANTS

BSC-(P)-3-LS-302-DEVEKIOMENTAL-BIOLOGY-AND-PHYSIOLOGY-ANIMALS

BSC-(P)-3-LS-302-DEVELOPMENTAL-BIOLOGY-AND-PHYSIOLOGY-ANIMALS

BSC-(P)-3-LS-303-ECOLOGY-AND-ENVIRONMENTAL-MANAGEMENT-2

BSC-(P)-3-LS-303-ECOLOGY-AND-ENVIRONMENTAL-MANAGEMENT

BSC-(P)-3-LS-304-APPLIED-BIOLOGY-AND-BIOTECHNOLOGY

BSC-(P)-3-MA-301-MATHEMATICS-(REAL-ANALYSIS)

BSC-(P)-3-MA-301-MATHEMATICS

BSC-(P)-3-MA-302-MATHEMATICS-ANALYSIS-ALGEBRA-AND-MECHANICS

BSC-(P)-3-MATHEMATICS-MA-302-ANAKYSIS-ALGEBRA-AND-MECHANICS

BSC-(P)-3-MP-302-OPTICS-ELECTRONICS-AND-MODERN-PHYSICS-1

BSC-(P)-3-MP-302-OPTICS-ELECTRONICS-AND-MODERN-PHYSICS

BSC-(P)-3-OPERATIONAL-RESEARCH-OR-302-FORECASTING

BSC-(P)-3-OR-301-OPERATIONAL-RESEARCH-RELIABILITY-AND-STATISTICAL-QUALITY-CONTROL-1

BSC-(P)-3-OR-301-OPERATIONAL-RESEARCH-RELIABILITY-AND-STATISTICAL-QUALITY-CONTROL

BSC-(P)-3-OR-302-OPERATIONAL-RESEARCH-FORECASTING-(NC

BSC-(P)-3-PAPER-BIO-301-CELL-MOLECULAR-BIOLOGY-AND-DEVELOPEMENTAL-BIOLOGY

BSC-(P)-3-PH-301-PHYSICS-(ELECTROMAGNETIC-THEORY)

BSC-(P)-3-PH-301-PHYSICS-PHUSICS-OF-MATERIAL-AND-ELECTRONICS

BSC-(P)-3-PH-301-PHYSICS-PHYSICS-OF-MATERIALS-AND-ELECTRONICS

BSC-(P)-3-PH-302-PHYSICS-MODERN-PHYSICS

BSC-(P)-AGROCHEM-AND-POST-MGT

BSC-(P)-AGROCHEM-ANDPEST-MGT-SEM-IV

BSC-(P)-ANALYTICAL-4-SEPRATION-METHODS-2-SEM-IV

BSC-(P)-ANALYTICAL-CHEMISTRY-2-ACPT-202-SEM-II

BSC-(P)-ANALYTICAL-CHEMISTRY-I

BSC-(P)-ANALYTICAL-CHEMISTRY-III

BSC-(P)-APLLIED-LIFE-SCIENCES-PAPER-16-FUNGICIDES-SEM-IV

BSC-(P)-APPLIED-LIFE-SCIENCE-(III-YEAR)-GENETICSBIOTECHNOLOGY-AND-IMMUNOLOGY-(5127)

BSC-(P)-APPLIED-LIFE-SCIENCE-2-YEAR-BIOLOGY-OF-LIFE-FORMS

BSC-(P)-APPLIED-LIFE-SCIENCE-PAPER10-BIOLOGY-OF-LIFE-FORMS-SEM-3-(6811)

BSC-(P)-APPLIED-PHY-SC-ANALYTICAL-CHEMISTRY-ACPT-303-ANALYTICAL-CHEMISTRY-3-SEM-3-(6993)

BSC-(P)-APPLIED-PHYSICAL-SCIENCE-(INDUSTRIAL-CHEMISTRY)-PART-I

BSC-(P)-APPLIED-PHYSICAL-SCIENCES-ANALYTICAL-CHEMISTRY-(P)-APPLIED-PHYSICAL-SCIENC

BSC-(P)-APPLIED-PHYSICAL-SCIENCES-ICPT-202-SEM-II

BSC-(P)-APPLIED-PHYSICAL-SCIENCES-INDUSTRIAL-CHEMISTRY-3-(INORGANIC-MATHERIALS)

BSC-(P)-CH-201-INORGANIC-CHEMISTRY

BSC-(P)-CHPT-101-CHEMISTRY-1SEM-1-(6801)

BSC-(P)-CHPT-PHYSICAL-CHEMISTRY-ORGANIC-CHEMISTRY-SEM-II

BSC-(P)-COMMUNICATION-ELECTRONICS-

BSC-(P)-CONVENTIONAL-AND-BIOLOGICAL-INSECTICIDE-SEM-V-(6818)

BSC-(P)-EARTH-SYSTEM-SCIENCE

BSC-(P)-ECONOMICS

BSC-(P)-ELEC-2-ANALOG-CIRCUITS-ELPT-202-SEM-II

BSC-(P)-HERBICIDES-PAPER-12-SEM-3-(6813)

BSC-(P)-INDUSTRIAL-CHEMISTRY

BSC-(P)-LIFE-SC-DEVELOPMENTAL-BIOLOGY-AND-PHYSIOLOGY-PLANTS-(LSPT-511)-SEM-V-(6917)

BSC-(P)-LIFE-SCIENCE-3-SEM-PAPER-LSPT-305-BIODIVERSITY-2-'ANIMALS'

BSC-(P)-LIFE-SCIENCE-3-SEM-PAPER-LSPT-306-(INTRODUCTION-TO-MEDICAL-DIAGNOSTICS)

BSC-(P)-LIFE-SCIENCE-3-ZOOLOGY-(INTRODUCTION-TO-MEDICAL-DIAGNOSTICS)

BSC-(P)-LIFE-SCIENCE-AGROCHEMICALS-AND-PEST-MANAGEMENT-PAPER-7-SOILS-AND-FERTILIZERS-SEM-II

BSC-(P)-LIFE-SCIENCE-BIODIVERSITY-1-MICROBES-(LSPT-304)-SEM-2-(6911)

BSC-(P)-LIFE-SCIENCE-PHYSICAL-SCIENCE-IST-SEM-PAPER-CHPT-101

BSC-(P)-LIFE-SCIENCES-FOOD-NUTRITION-AND-HEALTH-LSPT-203-SEM-2-2

BSC-(P)-LIFE-SCIENES-V-GENETICS-AND-GENOMICS

BSC-(P)-LSPT-306-INTRODUTION-TI-MEDICAL-DIAGNOSTICS-SEM-2-(6913)

BSC-(P)-LSPT-408-BIODIVERSITY-3-PLANTS-SEM-IV

BSC-(P)-MATHEMATICAL-SCIENCE-BIOTECHNOLOGY-EL-310-(III)-SEM-V-(6960)

BSC-(P)-MATHEMATICAL-SCIENCES-1-SEM-PAPER-STP-101-DESCRIPTIVE-STATISTICS

BSC-(P)-MOLECULAR-BIOLOGY-LSPT-407-SEM-IV

BSC-(P)-OPERATING-SYSTEM-(CSPT-404)-SEM-IV

BSC-(P)-ORGANISATIONAL-BEHAVIOUR

BSC-(P)-PART-1-COMPUTATIONAL-SKILLS

BSC-(P)-PART-3-CSCT-501DATABASE-AND-VISUAL-BASIC-SEM-V-(6870)

BSC-(P)-PART-3-DATABASE-AND-VISUAL-BASIC-V

BSC-(P)-PH-2-WAVES-AND-OPTICS-(PHPT-303)-SEM-IV

BSC-(P)-PHYSICAL-SC-CHCT-501-CHEMISTRY-1-SEM-V-(6869)

BSC-(P)-PHYSICAL-SC-PHYSICS-3-WAVES-AND-OPTICS-(PHPT-303)-SEM-3-(6858)

BSC-(P)-PHYSICAL-SCIENCE-1-SEM-PAPER-PHPT-101-MACHANICS

BSC-(P)-PHYSICAL-SCIENCE-APPLIED-PHYSICAL-SCIENCE-PHPT-202-PHYSICS-2-THERMAL-PHYSICS-SEM-II

BSC-(P)-PHYSICAL-SCIENCE-COMPUTER-SC-2-DATA-STRUCTURE-CSPT-202-SEM-II

BSC-(P)-PHYSICAL-SCIENCE-LIFE-SCIENCE-CHEMISTRY-III

BSC-(P)-PHYSICAL-SCIENCE-LIFE-SCIENCE-CHPT-505-CHEMISTRY-VSEM-V-(6815)

BSC-(P)-PHYSICAL-SCIENCE-LIFE-SCIENCE-V-CHEMISTRY-V

BSC-(P)-PHYSICAL-SCIENCE-PAPER-13-CHPT-404-INORGANIC-AND-PHYSICAL-CHEMISTRY-SEM-IV

BSC-(P)-PHYSICAL-SCIENCE-PART-3-QUANTUM-MECHANICS-AND-ATOMIC-PHYSICS-V

BSC-(P)-PHYSICAL-SCIENCES-1-SEM-PAPER-ELPT-101-NETWORK-ANALYSIS

BSC-(P)-PHYSICAL-SCIENCES-1-V-SEM-PAPER-PHPT-404

BSC-(P)-PHYSICAL-SCIENCES-2-SEM-PAPER-ELPT-202

BSC-(P)-PHYSICAL-SCIENCES-2-SEM-PAPER-PHPT-202-THERMAL-PHYSICS

BSC-(P)-PHYSICAL-SCIENCES-3-SEM-PAPER-ELPT-303-ELECTRONIC-INSTRUMENTATION

BSC-(P)-PHYSICAL-SCIENCES-3-SEM-PAPER-PHPT-303-WAVES-AND-OPTICS

BSC-(P)-PHYSICAL-SCIENCES-IV-SEM-PAPER-ELPT-404

BSC-(P)-PHYSICAL-SCIENCES-PART-IIII-(CONCURRENT-COURSE-CHEMISTRY-I

BSC-(P)-PHYSICS-1-V-(ELECTRICITYMAGNETISM-AND-ELECTROMAGNETIC-THEORY)-(PHPT-404)-SEM-IV

BSC-(P)-POLYMER-SCIENCE-(2)

BSC-(P)-POLYMER-SCIENCE

BSC-(P)-PSYCHOLOGY

BSC-(P)-SEM-1-MATHEMATICAL-SCIENCES-CONCURRENT-COURSE-CSCT-301

BSC-(P)-SEM-1-MATHEMATICAL-SCIENCES-PAPER-OR-1-OPERATIONAL-RESEARCH-I

BSC-(P)-SEM-1-MATHEMATICAL-SCIENCES-PAPER-ORC-1-OPETATIONAL-RESEACH-CONCURRENT-1

BSC-(P)-SEM-2-MATHEMATICAL-SCIENCES

BSC-(P)-STRUCTURE-COURSES-MATHEMATICAL-SCIENCES-2-SEM-PAPER-STP-202-STATISTICAL-MEHTOD-1

BSC-(P)-TECH-WRITTING-AND-COMMUNICATION-IN-ENGLISH-SEM-1-(6804)

BSC-(PHYSICAL-MATHEMATICAL-SCIENCES)-SEM-2-COMPUTER-SCIENCE-PAPER-CSPT-202

BSC-(PHYSICAL-SC)-PHYSICS-V-QUANTUM-MECHANICS-AND-ATOMIC-PHYSICS-(PHPT-505)-SEM-V-(6868)

BSC-(PHYSICAL-SC-APPLIED-PHYSICAL-SCIENCE)-ELTC-501-ELECTRONICS-CIRCUITS-SEM-V-(6871)

BSC-(PHYSICAL-SCIENCE)-2-SEM-PAPER-MAPT-101

BSC-(PHYSICAL-SCIENCE)-ELECTRONICS-INSTRUMENTATION-(ELPT-303)-SEM-1-(6857)

BSC-(PHYSICAL-SCIENCE)-IST-SEM-PAPER-MAPT-101-MATHEMATICS-1

BSC-(PHYSICAL-SCIENCE-1-V-SEM-PAPER-MAPT-404

BSC-(PHYSICAL-SCIENCE-APPLIED-PHYSICAL-SCIENCE-MECHANICS-AND-DISCRETE-MATHEMATICS-MAPT-606-SEM-VI

BSC-(PHYSICAL-SCIENCES)-3-COMPUTER-SCIENCE-II

BSC-(PHYSICAL-SCIENCES)-PART-1-COMPUTER-SCIENCE-1-FUNDAMENTAL-OF-PROGRAMMING

BSC-(PHYSICAL-SCIENCES-LIFE-SCIENCES)-(SEMESTER-III)-CHEMISTRY-PAPER-CHPT-303

BSC-(PHYSICAL-SCIENCES-LIFE-SCIENCES)-SEM-2-CHEMISTRY-PAPER-CHPT-202

BSC-1-CHEMISTRY-PAPER-2-(ORGANIC-CHEMISTRY)

BSC-1-INDUSTRIAL-CHEMISTRY-1-PAPER-ICPT-101-(INDUSTRIAL-CHEMISTRY-AND-ENVIRONMENT)

BSC-1-NS-COMPUTER-SCIENCE-PAPER-1-(ADMISSIONS-OF-1999-AND-ONWARDS)

BSC-1-SEM-STATISTICS-PAPER-STH-102-(CALCULUS-1)-(ADMISSIONS-OF-11-AND-ONWARDS)

BSC-1-SEM-STATISTICS-PAPER-STH-103-(ALGEBRA-1)-(ADMISSIONS-OF-11-AND-ONWARDS)

BSC-1-SEM-STATISTICS-PAPER-STH-104-(PROBABILITY-AND-STATISTICAL-METHODS-1)

BSC-2-CHEMISTRY-ANALYTICAL-METHODS-IN-CHEMICAL-ANALYSIS-CHHT-204-SEM-II

BSC-2-ES-201-CONCEPTS-OF-ECOLOGY

BSC-2-PHYSICS-PAPER-XII-(QUANTUM-MECHANICS-AND-NUCLEUR-PHYSICS)

BSC-2-ZOOLOGY-PAPER-3-(ANIMAL-DIVERAITY-2-(CHORDATA)

BSC-3-CHEMISTRY-PAPER-XVII-(PHYSICAL-CHEMISTRY-III)

BSC-3-ES-301-ENVIRONMENTAL-CONCERNS-AND-HEALTH

BSC-3-MATHEMATICAL-SCIENCES-PAPER-VI-(OPERATIONAL-RESEARCH)

BSC-3-MATHEMATICS-PAPER-XVI-(6749)

BSC-3-NS-COMPUTER-SCIENCE-PAPER-V-(DATA-BASE-SYSTEMS)

BSC-3-NS-COMPUTER-SCIENCE-PAPER-VI-(MULTIMEDIA-SYSTEM-AND-APPLICATION-OPERATIN-SYSTEM)

BSC-3-NS-MATHEMATICAL-SCIENCES-(OPERATIONAL-RESEARCH)-PARER-V

BSC-AGROCHEMICAIS-AND-PEST-MANAGEMENT-3-BILOGY-OF-ANIMALS

BSC-ALGEBRA-V-MATHEMATICS-VI-8132

BSC-ANALYSIS-V-(6-1)-(H)-MATHEMATICS-VI-8131

BSC-ANTHROPOLOGY-2-SEM-PAPER-ANTH-204-ARCHAEOLOGICAL-ANTHROPOLOGY

BSC-ANTHROPOLOGY-2-SEM-PAPER-ANTH-205-ANTHROPOLOGY-OF-KINSHIP

BSC-ANTHROPOLOGY-FUNDAMENTALS-OF-BIOLOGICAL-ANTHROPOLOGY-(DC-1-1)-SEM-1-(7756)

BSC-APPLIED-LIFE-SCIENCE-AGRO-CHEMICAL-AND-PEST-MANAGEMENT-APPLIED-ENTOMOLOGY-SEM-V-(6817)

BSC-APPLIED-PHYSICAL-S-(PART-1)-MAPT-101-CALCULUS-AND-MATRICES-2-(7006)

BSC-APPLIED-PHYSICAL-SCIENCE-(ELECTRONICS)-PART-1-NETWORK-ANALYSIS

BSC-APPLIED-PHYSICAL-SCIENCES-ANALYTICAL-CHEMISTRY-ACPT-101-ANALYTICAL-CHEMISTRY-1-SEM-(6987)

BSC-APPLIED-PHYSICAL-SCIENCES-PART-2-(ELECTRONICS)-3-ELECTRONIC-INSTRUMENTATION

BSC-BA-(H)-2-MATHEMATICS-UNIT-VI

BSC-BA-(H)-2-MATHEMATICS-UNIT-VII-MECHANICS-1

BSC-BA-(H)-2-MATHEMATICS-UNIT-VIII

BSC-BA-(H)-2-MATHEMATICS-UNIT-X

BSC-BA-(H)-3-MATHEMATICS-PAPER-XIV

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVI

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(I)

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(II)

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(III)

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(IV)

BSC-BA-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(VI)

BSC-BA-(H)-3-MATHEMATICS-UNIT-12

BSC-BA-(H)-3-MATHEMATICS-UNIT-XI

BSC-BA-(H)-3-MATHEMATICS-UNIT-XIII

BSC-BA-(H)-3-MATHEMATICS-UNIT-XV

BSC-BA-(H)-GEOLOGY-PART-2-STRUCTURAL-GEOLOGY-III

BSC-BA-BSC-(H)-1-MATHEMATICS-UNIT-2

BSC-BA-BSC-(H)-2-MATHEMATICS-UNIT-IX

BSC-BA-BSC-(H)-2-MATHEMATICS-UNIT-V

BSC-BA-BSC-(H)-3-MATHEMATICS-PAPER-XVII-AND-XVIII-(V)

BSC-BACHELOR-IN-CHEMISTRY-(H)-ORGANIC-BTION-B-(PHYSICAL-CHEMISTRY-SEM-1-(7786)

BSC-BIOMEDICAL-SCIENCES-(DC-1-4)-HUMAN-PHYSIOLOGY-AND-ANATOMY-1-2-(7952)

BSC-BOTANY-BIODIVERSITY-2-(MYCOLOGY-AND-PHYTOPATHOLOGY)-SEM-II

BSC-BOTANY-BTHT-612-PLANT-BIOTECHNOLOGY-SEM-VI

BSC-BOTANY-PLANT-DEVELOPMENT-AND-ANATOMY-BTHT-405-SEM-IV

BSC-BOTANY-PLANT-ECOLOGY-AND-PHYTOGEOGRAPHY-(BTHT-406)-SEM-IV

BSC-BOTANY-PLANT-METABOLISM-AND-BIOCHEMISTRY-(BTHT-610)-SEM-VI

BSC-BSC-(H)-1-BOTANY-1-(INTRODUCTION-TO-THE-PLANT-WORLD-AND-PHYCOLOGY)

BSC-BSC-(H)-1-PH-101-PHYSICS

BSC-BSC-(P)-BSC-(H)-1-PAPER-BY-105-BIOLOGY

BSC-BSC-1-COMPURER-SCIENCE-PAPER-1-PROGRAMMING-FUNDAMENTALS-AND-DATA-STRUTURES)

BSC-BSC-1-COMPUTER-SCIENCE-PAPER-I

BSC-BSC-2-CHEMISTRY-PAPER-VI

BSC-BSC-2-COMPUTER-SCIENCE-PAPER-IV-(COMPUTER-NETWORKS-AND-INTERNEL)

BSC-BSC-2-COMPUTER-SCIENCE-PAPER-IV-(COMPUTER-NETWORKS-AND-INTERNET)

BSC-BSC-2-MATHEMATICAL-SCIENCES-OPERATIONAL-RESEARCH-PAPER-IV

BSC-BSC-2-NS-COMPUTER-SCIENCE-PAPER-IV

BSC-BSC-2-NS-PHYSICS-PAPER-III

BSC-BSC-2-SEM-ALSO-COMMON-FOR-BOTANY-ZOOLOGY-MICROBIOLOGY-COURSES

BSC-BSC-2-SEM-INDUSTRIAL-CHEMISTRY-1-PAPER-ICPT-202

BSC-BSC-3-COMPUTER-SCIENCE-PAPER-V-DATA-BASE-SYSTEMS

BSC-BSC-3-COMPUTER-SCIENCE-PAPER-VI-(MULTIMEDIA-SYSTEM-AND-APPLICATION-OPEATING-SYSTEM)

BSC-BSC-3-MATHEMATICAL-SCIENCE-PAPER-VI-(A)-(OPERATIONAL-RESEACAH)-(STATISTICAL-QUALITY-CONTROL-AND-FORECASTING)

BSC-BSC-3-MATHEMATICAL-SCIENCES-OPERATIONAL-RESEARCH-PAPER-V

BSC-BSC-3-MP-301-MATHEMATICS-2

BSC-BSC-ANTHROPOLOGY-1-SEM-PAPER-ANTH-206-BIOSTATISTICS-AND-DATA-ANALYSIS

BSC-BSC-MATH-SC-COMPUTER-NETWORKS-(CSPT-505)-SEM-V-(5024)

BSC-BSC-MATH-SC-FUNDAMENTALS-OF-PROGRAMMING-(CSPT-101)-SEM-1-(5003)

BSC-BSC-MECHANICS-VI-8135

BSC-BSC-V2

BSC-BSE-3-MATHEMATICAL-SCIENCES-PAPER-VI-(OPERATIONAL-RESEARCH)-(STATISTICAL-QUALITY-CONTROL-AND-FORECASTING)-(8056)

BSC-CHEMISTRY-1-SEM-PAPER-CHHT-101-(INORGANIC-CHEMISTRY-1)

BSC-CHEMISTRY-2-SEM-PAPER-CHHIT-203-PHYSICS-CHEMITEY

BSC-CHEMISTRY-CHHT-305-INORGANIC-CHEMISTRY-2-SEM-3-(6010)

BSC-CHEMISTRY-CHHT-306-ORGANIC-CHEMISTRY-2-SEM-3-(6011)

BSC-CHEMISTRY-CHHT-511-1-NORGANIC-CHEMISTRY-1-V-SEM-(6015)

BSC-CHEMISTRY-PHYSICAL-CHEMISTRY-2-(CHHT-307)-SEM-3-(6012)

BSC-CHEMISTRYINORGANIC-CHEMISTRY-1-(CHHT-101)-SEM-1-(6005)

BSC-COMP-SC-1-SEM-PAPER-CSHT101-PROGRAMMING-FUNDAMENTALS

BSC-COMP-SC-1-SEM-PAPER-CSHT102-DISCRETE-STRUCTURES

BSC-COMP-SC-DATA-COMMUNICATION-AND-COMPUTER-NETWORKS-(CSHT-409)-SEM-IV

BSC-COMPUTER-SC-2-SEM-PAPER-205-(II)-FINANCIAL-MANAGEMENT

BSC-COMPUTER-SC-IV-SEM-PAPER-404-DIFFERENTIAL-EQUATIONS

BSC-COMPUTER-SC-OPREATING-SYSTEM-(CSHT-408)-SEM-IV

BSC-COMPUTER-SC-V-SEM-PAPRER-502-CIMPUTER-NETWORKS

BSC-COMPUTER-SCI-VI-SEM-PAPER-603-COMPUTER-GRAPHICS

BSC-COMPUTER-SCI-VI-SEM-PAPER-604-OPERATIONAL-RESEARCH

BSC-COMPUTER-SCI-VI-SEM-PAPER-605-(I)-ARTIFICIAL-INTELLIGENCE

BSC-COMPUTER-SCIENCE-2-SEM-PAPER-201-DATA-STRUCTURE

BSC-COMPUTER-SCIENCE-2-SEM-PAPER-202-COMPUTER-SYSTEM-ARCHITECTURE

BSC-COMPUTER-SCIENCE-COMPUTER-SYSTEM-ARCHITECTURE-(CSHT-204)-SEM-II

BSC-COMPUTER-SCIENCE-DATA-STRUCTURE-(CSHT-203)-SEM-II

BSC-COMPUTER-SCIENCE-DATABASE-SYSTEMS-(CSHT-307)-SEM-3-(6074)

BSC-COMPUTER-SCIENCE-DISCRETE-STRUCTURES-(CSHT-102)-COMPUTER-SCIENCE-SEM-1-(6066)

BSC-COMPUTER-SCIENCE-IV-SEM-PAPER-403-PROGRAMMING-PARADIGMS

BSC-COMPUTER-SCIENCE-IV-SEM-PAPER-405-TECHNICAL-COMMUNICATION

BSC-COMPUTER-SCIENCE-MICROPROCESSORS-(CSHT-512)-SEM-V-(6076)

BSC-COMPUTER-SCIENCE-SOFTWARE-ENGINEERING-(CSHT-410)-SEM-IV

BSC-CONPUTER-SCIENCE-2-SEM-PAPER-205-(III)-LOGIC

BSC-CREDIT-COURSE-FOR-(H)-MATHEMATICS-SCIENCE-MATHEMATICAL-SCIENCE-2-5828

BSC-DATA-STRUCTURE-(CSPT-202)-MATHEMATICAL-SCIENCES-PHYSICAL-SCIENCES-2-5037

BSC-DIFFERENTIAL-EQUATIONS-1-(DC-1-4)-(H)-IN-MATHEMATINS-2-(7851)

BSC-DIGITAL-COMMUNICATION-(ELHT-602)-(H)-ELECTRONICS-VI-6479

BSC-DIGITAL-ELECTRONICS-(ELPT-404)-PHYSICAL-SCIENCES-(ELECTRONICS)-1-V-6887

BSC-ELECTRICAL-MACHINES-(ELHT-601)-(H)-ELECTRONICS-VI-6478

BSC-ELECTROMAGNETICS-(ELHT-403)-(H)-ELECTRONICS-1-V-6476

BSC-ELECTRONCS-ELHT-504-WAVE-PROPAGATION-AND-ANTENNA-SEM-V-(6463)

BSC-ELECTRONICS-2-SEM-PAPER-ELHP-205-ELECTRONICS-PRACTICAL-3

BSC-ELECTRONICS-2-SEM-PAPER-ELHP-206-ELECTRONICS-PRACTICAL-1-V

BSC-ELECTRONICS-2-SEM-PAPER-ELHT-202-SEMICONDUCTOR-DEVICES

BSC-ELECTRONICS-3-SEM-PAPER-CS-1-FUNDAMENTALS-OF-PROGRAMMING

BSC-ELECTRONICS-3-SEM-PAPER-ELHP-305-ELECTRONICS-PRACTICAL

BSC-ELECTRONICS-3-SEM-PAPER-ELHP-306-ELECTRONICAL-VI

BSC-ELECTRONICS-3-SEM-PAPER-ELHT-301-DIGITAL-ELECTRONICS

BSC-ELECTRONICS-3-SEM-PAPER-ELHT-302-ANALOG-ELECTRONICS-1

BSC-ELECTRONICS-ANALOG-ELECTRONICS-2-ELHT-402-SEM-IV

BSC-ELECTRONICS-DIGITAL-COMMUNICATION-ELHT-602-SEM-VI

BSC-ELECTRONICS-DIGITAL-ELECTRONICS-(ELHT-301)-SEM-3-(6450)

BSC-ELECTRONICS-ELECTRONICAL-MACHINES-ELHT-601-SEM-VI

BSC-ELECTRONICS-ELECTRONICAL-PRACTICAL-3-ELHP-205-SEM-II

BSC-ELECTRONICS-ELECTRONICS-PRACTICAL-1-V-(ELHP-206)-SEM-II

BSC-ELECTRONICS-ELECTRONICS-PRACTICAL-VII-ELHP-405-SEM-IV

BSC-ELECTRONICS-ELECTRONICS-PRACTICAL-VIII-(ELHP-406)-SEM-IV

BSC-ELECTRONICS-ELHT-403-ELECTROMAGNETICS-SEM-IV

BSC-ELECTRONICS-ELHT-503-ELECTRONICS-INSTRUMENTATION-SEM-V-(6462)

BSC-ELECTRONICS-IST-SEM-PAPER-ELHP-105-ELECTRONICS-PRACTICALS-1

BSC-ELECTRONICS-IST-SEM-PAPER-ELHP-106-ELECTRONICS-PRACTICALS-2

BSC-ELECTRONICS-IST-SEM-PAPER-ELHT-101-(APPLIED-QUANTUM-MECHANICS)

BSC-ELECTRONICS-IST-SEM-PAPER-ELHT-102-(ENGINEERING-MATERIALS)

BSC-ELECTRONICS-IST-SEM-PAPER-ELHT-103-NETWORKS-ANALYSIS

BSC-ELECTRONICS-NUMERICAL-TECHNIQUES-ELHT-401-SEM-IV

BSC-ELECTRONICS-SEMICONDUCTOR-DEVICES-ELHT-202-SEM-II

BSC-ELECTRONICS-SIGNALS-AND-SYSTEM-ELHT-201-SEM-II

BSC-ELECTRONISCS-2-SEM-PAPER-ELHT-201-SIGNALS-AND-SYSTEMS

BSC-ENGLISH-FOR-(H)-(H)-MATH-(MATHEMATICAL-SCIENCE)-SEM-VI-(1919)

BSC-ENGLISH-FOR-(H)-(H)-MATH-SEM-VI-(1918)

BSC-FINANCIAL-ACCOUNTING-(H)-MATHEMATICS-IV-6687

BSC-HONOU-1-PHYSICS-PAPER-1-PROPERTIES-OF-MATTER

BSC-HONOURS-1-CHEMISTRY-PAPER-1-INORGANIC

BSC-HONOURS-1-EXAMINATION-BITANY-PAPER-1-(PLANT-DIVERSITY)

BSC-HONOURS-1-MATHEMATICS-PAPER-I

BSC-HONOURS-1-PHYSICS-PAPER-2-(THERMAL-PHYSICS)

BSC-HONOURS-1-ZOOLOGY-PAPER-I

BSC-HONOURS-1-ZOOLOGY-PAPER-II

BSC-HONOURS-2-CHEMISTRY-PAPER-3-INORGANIC

BSC-HONOURS-2-PAPER-IV-CHEMISTRY-ORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-HONOURS-2-PHYSICS-PAPER-3-WAVES-AND-OSCILLATION

BSC-HONOURS-2-PHYSICS-PAPER-IV-ELECTROMAGNETISM-AND-ATOMIC-PHYSICS

BSC-HONOURS-2-ZOOLOGY-PAPER-3-ANIMAL-DIVERSITY-2-(CHORDATA)

BSC-HONOURS-2-ZOOLOGY-PAPER-IV-(PHYSIOLOGY-W-R-T-HUMAN)

BSC-INDUSTRIAL-CHEMISTRY-4

BSC-LIFE-SCIENCE-2-SEM-PAPER-LSPT-203-FOOD-NUTRITION-AND-HEALTH

BSC-LIFE-SCIENCE-3-SEM-PAPER-LSPT-304-(BIODIVERSITY-1-MICROBES)

BSC-LIFE-SCIENCE-BIODIVERSITY-1-MICROBES-III

BSC-LIFE-SCIENCE-BIOLOGY-OF-ANIMALS-FORMSSTRUCTURE-AND-FUNCTION-ALS-2-SEM-3-(6812)

BSC-LIFE-SCIENCE-GENETICS-AND-GENOMICS-(LSPT-512)-SEM-V-(6918)

BSC-LIFE-SCIENCE-PHYSICAL-SCIENCE-BSC-(H)-BOTANY-ZOOLOGY-1-(INTRODUCTION-TO-BIOLOGY

BSC-LIFE-SCIENCES-BIODIVERSITY-2-(ANIMALS)-III

BSC-LIFE-SCIENCES-LSPT-510-BIOCHEMISTRY-AND-IMMUNOLOGY-SEM-V-(6916)

BSC-LIFE-SCIENCES-V-BIOCHEMISTRY-AND-IMMUNOLOGY

BSC-MATH-MATHEMATICAL-SCIENC-SEM-VI-(1932)

BSC-MATHEMATICAL-AWARENESS-(H)-1-2-8153

BSC-MATHEMATICAL-FINANCE-(H)-MATHEMATICS-VI-8134

BSC-MATHEMATICAL-METHODS-(OTHER-THAN-ECONOMICS)-VI-8147

BSC-MATHEMATICAL-SCIENCE-(CONCURRENT-COURSE)-1-LINUX-SYSTEM-ADMINISTRATION

BSC-MATHEMATICAL-SCIENCE-(CONCURRENT-CREDIT-COURSE)-3-(I)-FORENSIC-SCIENCE-(EL-310-(IV)-SEM-V-(6961)

BSC-MATHEMATICAL-SCIENCE-(H)-MATHS-PHYSICS-1-SEM-3-1-(5821)

BSC-MATHEMATICAL-SCIENCE-FINANCIAL-ACCOUNTING-SEM-V-(6658)

BSC-MATHEMATICAL-SCIENCES-NETWORK-ANALYSIS-AND-THEORY-OF-SEQUENCING-(ORP-5)-SEM-V-(5022)

BSC-MATHEMATICAL-SCIENCES-OPERATIONAL-RESEARCH-1-(LINEAR-PROGRAMMING)-SEM-1-(5006)

BSC-MATHEMATICAL-SCIENCES-OPERATIONAL-RESEARCH-3-MATHEMATICAL-PROGRAMMING-SEM-3-(5011)

BSC-MATHEMATICAL-SCIENCES-OPERATIONAL-RESEARCH-LINEAR-PROGRAMMING

BSC-MATHEMATICAL-SCIENCES-PHYSICS-2-SEM-V-(6661)

BSC-MATHEMATICS-1-(MAHT-204)-(H)-ELECTRONICS-2-6470

BSC-MATHEMATICS-2

BSC-MATHEMATICS-IV-(LINEAR-ALGEBRA-AND-CALCULUS)-(HOND)-3-(FOR-ECONOMICS-(H)-VI-8149

BSC-MATHEMATICS-MATHEMATICAL-SCIENCE-(CREDIT-COURSE-1)-FINANCIAL-MANAGEMENT-SEM-1-(5822)

BSC-MATHEMATICS-PART-2-NUMERICAL-METHODS-AND-PROGRAMMING-(PAPER-3-2)-SEM-3-(6611)

BSC-MICROBIOLOGY-1-SEM-PAPER-MITH-101-(INTRODUCTION-TO-MICROBIAL-WORLD)

BSC-MICROBIOLOGY-1-SEM-PAPER-MITH-102-BACTERIOLOGY

BSC-MICROBIOLOGY-3-SEM-PAPER-MITH-304-VIROLOGY

BSC-MICROBIOLOGY-3-SEM-PAPER-MITH-305-MICROBIAL-PHYSIOLOGY-AND-METABOLISM-1

BSC-MICROBIOLOGY-PART-1-PHYCOLOGY-AND-MYCOLOGY-SEM-II

BSC-MICROBIOLOGY-PART-2-MICROBIAL-PHYSIOLOGY-AND-METABOLISM-2-SEM-IV

BSC-MICROBIOLOGY-PART-2-MIHT-407-MICROBIAL-ECOLOGY-SEM-IV

BSC-MICROPROCESSOR-(ELPT-606)-PHYSICAL-SCIENCE-(ELECTRONICS)-VI-6894

BSC-NUMERICAL-TECHNIQUES-(ELHT-401)-(H)-ELECTRONICS-1-V-6472

BSC-OPTICS-AND-OPTICAL-ELECTRONICS-(ELHT-603)-(H)-ELECTRONICS-VI-6481

BSC-PEOG-1-PAPER-ES-111-ENVIRONMENTAL-STUDIES

BSC-PHY-SC-3-SEM-PAPER-CSPT-303-COMPUTER-SYSTEM-ARCHITECTURE

BSC-PHY-SC-SEM-1-PAPER-CSPT-101-COMPUTER-PROGRAMMING

BSC-PHYSICAL-SCI-LIFE-SCI-APPLIED-SCI-PART-1-CHEMISTRY-I

BSC-PHYSICAL-SCIENCE-(ELECTRONICS)-SEM-VI

BSC-PHYSICAL-SCIENCE-(PHPT-606)-SEM-VI

BSC-PHYSICAL-SCIENCE-2-SEM-PAPER-MAPT-202-MATHEMATICS-CALCULUS-AND-GEOMETRY

BSC-PHYSICAL-SCIENCE-APP-PHYSICAL-SCIENCE-PART-3-ELECTRONIC-CIRCUITS

BSC-PHYSICAL-SCIENCE-APPLIED-PHYSICAL-SCIENCE-PART-1-MECHANICS

BSC-PHYSICAL-SCIENCE-ELECTRONICS-1-NETWORK-ANALYSIS

BSC-PHYSICAL-SCIENCE-ELECTRONICS-V-COMMUNICATION-ELECTRONICS

BSC-PHYSICAL-SCIENCE-LIFE-SCIENCE-SEM-2-CHEMISTRY-PAPER-CHPT-202-PHYSICAL-CHEMISTRY-ORGANIC-CHEMISTRY

BSC-PHYSICAL-SCIENCE-LIFE-SCIENCE-SEM-2-CHEMISTRY-PAPER-CSPT-202-DATA-STRUCTURES

BSC-PHYSICAL-SCIENCE-LIFE-SCIENCE-SEM-2-ENAT-101-STH-101

BSC-PHYSICAL-SCIENCE-LIFE-SCIENCE-SEM-2-TECHNICAL-WRITING-AND-COMMUNICATION-IN-ENGLISH

BSC-PHYSICAL-SCIENCE-PART-3-MATHEMATICS-V-REAL-ANALYSIS

BSC-PHYSICAL-SCIENCE-SCIENCE-APP-PHYSICAL-SCIENCE-PART-2-PYSICS-3-WAVES-AND-OPTICS

BSC-PHYSICAL-SCIENCE-WITH-COMPUTER-SCIENCE-PART-3-COMPUTER-NETWORKS

BSC-PHYSICAL-SCIENCES-MATHEMATICAL-SCIENCES-MAPT-505-MATHEMATICS-V-REAL-ANALYSIS-SEM-V-(5023)

BSC-PHYSICS-1-MECHANICS-(PHPT-101)-SEM-1-6848

BSC-PHYSICS-MATHEMATICS-1-(PHHT-310)-(6210)

BSC-PHYSICS-MATHEMATICS-MATHEMATICAL-SCIENCE-CHEMISTRY-CHCT-101-SEM-1-(5826)

BSC-POLYMER-SCIENCE

BSC-PRINCIPLES-OF-ECONOMICS-MATHEMATICAL-SCIENCE-(H)-MATHEMATICS-CREDIT-COURSE-3-2-VI-8101

BSC-PROG-(H)-1-M-A-107-B-MATHEMATICS-(FOR-LIFE-SCIENCES)

BSC-PROG-(H)-1-PAPER-BY-105-BIOLOGY

BSC-PROG-(H)-SEM-1-MA-107-B-MATHEMATICS

BSC-PROG-1

BSC-PROG-2-CH-202-ORGANIC-CHEMISTRY

BSC-PROG-2-CH-203-PHYSICAL-CHEMISTRY

BSC-PROG-2-CH-302-CHEMISTRY-ORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-PROG-2-EL-210-(I)-ECONOMICS

BSC-PROG-2-EL-210-ECONOMICS

BSC-PROG-2-LS-201-BIODIVERSITY-1-PLANTS

BSC-PROG-2-MP-202-THERMAL-PHYSICS-AND-ELECTROMAGNETISM

BSC-PROG-2-PAPER-CH-201-INORGANIC-AND-PHYSICAL-CHEMISTRY

BSC-PROG-2-PAPER-CH-202-CHEMISTRY

BSC-PROG-2-PH-201-PHYSICS

BSC-PROG-2-PHYSICS-PH-202-THERMAL-PHYSICS-7-OPTICS

BSC-PROG-2-SEM-(CONCURRENT-COURSE-MATHEMATICAL-SCIENCES-CSCT-402-(I)

BSC-PROG-2-SEM-PAPER-CSAT-201-COMPUTER-SCIENCE-(COMPUTATIONAL-SKILLS

BSC-PROG-2

BSC-PROG-3-CH-301-INORGANIC-CHEMISTRY

BSC-PROG-3-CH-302-ORGANIC-CHEMISTRY

BSC-PROG-3-CH-303-PHYSICAL-CHEMISTRY

BSC-PROG-3-PH-302-PHYSICS-MODERN-PHYSICS

BSC-PROG-3

BSC-PROG-LIFE-SCIENCE-PHYSICAL-SCIENCE-1-V-SEM-PAPER-CHPT-404

BSC-PROG-SEM-1-MATHEMATICAL-SCIENCES-PAPER-ORC-1

BSC-PROG

BSC-PROGRAMME-MULTIMEDIA-SYSTEMS-AND-APPLICATION-CSCT-402-(I)-SEM-II

BSC-PROM-3-MP-301-MATHEMATICS-2

BSC-PROM-3-PHYSICS-PH-301-PHYSICS-PF-MATERIAL-ANDELECTRONICS

BSC-QULIFYING-FOR-(G)-MATHEMATICAL-SCIENCES-PAPER-ECONOMICS-(ECONOMIC-DEVELOPMENT-AND-PLNNING-IN-INDIA)

BSC-QULIFYING-FOR-(G)-MATHEMATICAL-SCIENCES-PAPER-FINANCIAL-ACCOUNTING

BSC-SAMPLE-SURVEYS-AND-DESIGN-OF-EXPERIMENTS-(STP-606)-(MATHEMATICAL-SCIENCES)-VI-5048

BSC-SEM-1-ANALYTICAL-CHEMISTRY-PAPER-ACPT-101-(BASIC-PRINCIPLES-OF-LOBORATORY-OPERATIONA)

BSC-SEM-2-ANALYTICAL-INDUSTRIAL-CHEMISTRY-PAPER-ACPT-1-CPT-202

BSC-SEMICONDUCTOR-DEVICES-(ELHT-202)-(H)-ELECTRONICS-2-6467

BSC-SIGNALS-AND-SYSTEMS-(ELHT-201)-(H)-ELECTRONICS-2-6465

BSC-STATISTICS-STHT-102-CALCULUS-1-SEM-1-(6697)

BSC-STATISTICS-STHT-103-ALGEBRA-1-SEM-1-(6698)

BSC-STATISTICS-STHT-304-SURVEY-SAMPLING-SEM-3-(6704)

BSC-SUBSIDIANRY-FOR-HONOURS-BOTANY-PAPER-2-(PLANTA-STRUCTURE)

BSC-SUBSIDIAR-FOR-(H)-COURSES-POLITICAL-SCIENCE-PAPER-3-COMPARATIVE-STUDY-OF-GOVERNMENT-AND-POLITICS

BSC-SUBSIDIARY-FOR-(H)

BSC-SUBSIDIARY-FOR-B